vendor: initial vendor

Signed-off-by: Tonis Tiigi <tonistiigi@gmail.com>

vendor/github.com/Microsoft/hcsshim/internal/guestrequest/types.go

@@ -0,0 +1,100 @@
+package guestrequest
+
+import (
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// Arguably, many of these (at least CombinedLayers) should have been generated
+// by swagger.
+//
+// This will also change package name due to an inbound breaking change.
+
+// This class is used by a modify request to add or remove a combined layers
+// structure in the guest. For windows, the GCS applies a filter in ContainerRootPath
+// using the specified layers as the parent content. Ignores property ScratchPath
+// since the container path is already the scratch path. For linux, the GCS unions
+// the specified layers and ScratchPath together, placing the resulting union
+// filesystem at ContainerRootPath.
+type CombinedLayers struct {
+	ContainerRootPath string            `json:"ContainerRootPath,omitempty"`
+	Layers            []hcsschema.Layer `json:"Layers,omitempty"`
+	ScratchPath       string            `json:"ScratchPath,omitempty"`
+}
+
+// Defines the schema for hosted settings passed to GCS and/or OpenGCS
+
+// SCSI. Scratch space for remote file-system commands, or R/W layer for containers
+type LCOWMappedVirtualDisk struct {
+	MountPath  string `json:"MountPath,omitempty"` // /tmp/scratch for an LCOW utility VM being used as a service VM
+	Lun        uint8  `json:"Lun,omitempty"`
+	Controller uint8  `json:"Controller,omitempty"`
+	ReadOnly   bool   `json:"ReadOnly,omitempty"`
+}
+
+type WCOWMappedVirtualDisk struct {
+	ContainerPath string `json:"ContainerPath,omitempty"`
+	Lun           int32  `json:"Lun,omitempty"`
+}
+
+type LCOWMappedDirectory struct {
+	MountPath string `json:"MountPath,omitempty"`
+	Port      int32  `json:"Port,omitempty"`
+	ShareName string `json:"ShareName,omitempty"` // If empty not using ANames (not currently supported)
+	ReadOnly  bool   `json:"ReadOnly,omitempty"`
+}
+
+// Read-only layers over VPMem
+type LCOWMappedVPMemDevice struct {
+	DeviceNumber uint32 `json:"DeviceNumber,omitempty"`
+	MountPath    string `json:"MountPath,omitempty"` // /tmp/pN
+}
+
+type LCOWNetworkAdapter struct {
+	NamespaceID     string `json:",omitempty"`
+	ID              string `json:",omitempty"`
+	MacAddress      string `json:",omitempty"`
+	IPAddress       string `json:",omitempty"`
+	PrefixLength    uint8  `json:",omitempty"`
+	GatewayAddress  string `json:",omitempty"`
+	DNSSuffix       string `json:",omitempty"`
+	DNSServerList   string `json:",omitempty"`
+	EnableLowMetric bool   `json:",omitempty"`
+	EncapOverhead   uint16 `json:",omitempty"`
+}
+
+type ResourceType string
+
+const (
+	// These are constants for v2 schema modify guest requests.
+	ResourceTypeMappedDirectory   ResourceType = "MappedDirectory"
+	ResourceTypeMappedVirtualDisk ResourceType = "MappedVirtualDisk"
+	ResourceTypeNetwork           ResourceType = "Network"
+	ResourceTypeNetworkNamespace  ResourceType = "NetworkNamespace"
+	ResourceTypeCombinedLayers    ResourceType = "CombinedLayers"
+	ResourceTypeVPMemDevice       ResourceType = "VPMemDevice"
+)
+
+// GuestRequest is for modify commands passed to the guest.
+type GuestRequest struct {
+	RequestType  string       `json:"RequestType,omitempty"`
+	ResourceType ResourceType `json:"ResourceType,omitempty"`
+	Settings     interface{}  `json:"Settings,omitempty"`
+}
+
+type NetworkModifyRequest struct {
+	AdapterId   string      `json:"AdapterId,omitempty"`
+	RequestType string      `json:"RequestType,omitempty"`
+	Settings    interface{} `json:"Settings,omitempty"`
+}
+
+type RS4NetworkModifyRequest struct {
+	AdapterInstanceId string      `json:"AdapterInstanceId,omitempty"`
+	RequestType       string      `json:"RequestType,omitempty"`
+	Settings          interface{} `json:"Settings,omitempty"`
+}
+
+// SignalProcessOptions is the options passed to either WCOW or LCOW
+// to signal a given process.
+type SignalProcessOptions struct {
+	Signal int `json:,omitempty`
+}

vendor/github.com/Microsoft/hcsshim/internal/guid/guid.go

@@ -0,0 +1,69 @@
+package guid
+
+import (
+	"crypto/rand"
+	"encoding/json"
+	"fmt"
+	"io"
+	"strconv"
+	"strings"
+)
+
+var _ = (json.Marshaler)(&GUID{})
+var _ = (json.Unmarshaler)(&GUID{})
+
+type GUID [16]byte
+
+func New() GUID {
+	g := GUID{}
+	_, err := io.ReadFull(rand.Reader, g[:])
+	if err != nil {
+		panic(err)
+	}
+	return g
+}
+
+func (g GUID) String() string {
+	return fmt.Sprintf("%02x%02x%02x%02x-%02x%02x-%02x%02x-%02x-%02x", g[3], g[2], g[1], g[0], g[5], g[4], g[7], g[6], g[8:10], g[10:])
+}
+
+func FromString(s string) GUID {
+	if len(s) != 36 {
+		panic(fmt.Sprintf("invalid GUID length: %d", len(s)))
+	}
+	if s[8] != '-' || s[13] != '-' || s[18] != '-' || s[23] != '-' {
+		panic("invalid GUID format")
+	}
+	indexOrder := [16]int{
+		0, 2, 4, 6,
+		9, 11,
+		14, 16,
+		19, 21,
+		24, 26, 28, 30, 32, 34,
+	}
+	byteOrder := [16]int{
+		3, 2, 1, 0,
+		5, 4,
+		7, 6,
+		8, 9,
+		10, 11, 12, 13, 14, 15,
+	}
+	var g GUID
+	for i, x := range indexOrder {
+		b, err := strconv.ParseInt(s[x:x+2], 16, 16)
+		if err != nil {
+			panic(err)
+		}
+		g[byteOrder[i]] = byte(b)
+	}
+	return g
+}
+
+func (g GUID) MarshalJSON() ([]byte, error) {
+	return json.Marshal(g.String())
+}
+
+func (g *GUID) UnmarshalJSON(data []byte) error {
+	*g = FromString(strings.Trim(string(data), "\""))
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/callback.go

@@ -0,0 +1,104 @@
+package hcs
+
+import (
+	"sync"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	nextCallback    uintptr
+	callbackMap     = map[uintptr]*notifcationWatcherContext{}
+	callbackMapLock = sync.RWMutex{}
+
+	notificationWatcherCallback = syscall.NewCallback(notificationWatcher)
+
+	// Notifications for HCS_SYSTEM handles
+	hcsNotificationSystemExited                      hcsNotification = 0x00000001
+	hcsNotificationSystemCreateCompleted             hcsNotification = 0x00000002
+	hcsNotificationSystemStartCompleted              hcsNotification = 0x00000003
+	hcsNotificationSystemPauseCompleted              hcsNotification = 0x00000004
+	hcsNotificationSystemResumeCompleted             hcsNotification = 0x00000005
+	hcsNotificationSystemCrashReport                 hcsNotification = 0x00000006
+	hcsNotificationSystemSiloJobCreated              hcsNotification = 0x00000007
+	hcsNotificationSystemSaveCompleted               hcsNotification = 0x00000008
+	hcsNotificationSystemRdpEnhancedModeStateChanged hcsNotification = 0x00000009
+	hcsNotificationSystemShutdownFailed              hcsNotification = 0x0000000A
+	hcsNotificationSystemGetPropertiesCompleted      hcsNotification = 0x0000000B
+	hcsNotificationSystemModifyCompleted             hcsNotification = 0x0000000C
+	hcsNotificationSystemCrashInitiated              hcsNotification = 0x0000000D
+	hcsNotificationSystemGuestConnectionClosed       hcsNotification = 0x0000000E
+
+	// Notifications for HCS_PROCESS handles
+	hcsNotificationProcessExited hcsNotification = 0x00010000
+
+	// Common notifications
+	hcsNotificationInvalid           hcsNotification = 0x00000000
+	hcsNotificationServiceDisconnect hcsNotification = 0x01000000
+)
+
+type hcsNotification uint32
+type notificationChannel chan error
+
+type notifcationWatcherContext struct {
+	channels notificationChannels
+	handle   hcsCallback
+}
+
+type notificationChannels map[hcsNotification]notificationChannel
+
+func newChannels() notificationChannels {
+	channels := make(notificationChannels)
+
+	channels[hcsNotificationSystemExited] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCreateCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemStartCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemPauseCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemResumeCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationProcessExited] = make(notificationChannel, 1)
+	channels[hcsNotificationServiceDisconnect] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashReport] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSiloJobCreated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemSaveCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemRdpEnhancedModeStateChanged] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemShutdownFailed] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGetPropertiesCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemModifyCompleted] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemCrashInitiated] = make(notificationChannel, 1)
+	channels[hcsNotificationSystemGuestConnectionClosed] = make(notificationChannel, 1)
+
+	return channels
+}
+
+func closeChannels(channels notificationChannels) {
+	for _, c := range channels {
+		close(c)
+	}
+}
+
+func notificationWatcher(notificationType hcsNotification, callbackNumber uintptr, notificationStatus uintptr, notificationData *uint16) uintptr {
+	var result error
+	if int32(notificationStatus) < 0 {
+		result = interop.Win32FromHresult(notificationStatus)
+	}
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return 0
+	}
+
+	if channel, ok := context.channels[notificationType]; ok {
+		channel <- result
+	} else {
+		logrus.WithFields(logrus.Fields{
+			"notification-type": notificationType,
+		}).Warn("Received a callback of an unsupported type")
+	}
+
+	return 0
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/cgo.go

@@ -0,0 +1,7 @@
+package hcs
+
+import "C"
+
+// This import is needed to make the library compile as CGO because HCSSHIM
+// only works with CGO due to callbacks from HCS comming back from a C thread
+// which is not supported without CGO. See https://github.com/golang/go/issues/10973

vendor/github.com/Microsoft/hcsshim/internal/hcs/errors.go

@@ -0,0 +1,287 @@
+package hcs
+
+import (
+	"encoding/json"
+	"errors"
+	"fmt"
+	"syscall"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+var (
+	// ErrComputeSystemDoesNotExist is an error encountered when the container being operated on no longer exists
+	ErrComputeSystemDoesNotExist = syscall.Errno(0xc037010e)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrElementNotFound = syscall.Errno(0x490)
+
+	// ErrElementNotFound is an error encountered when the object being referenced does not exist
+	ErrNotSupported = syscall.Errno(0x32)
+
+	// ErrInvalidData is an error encountered when the request being sent to hcs is invalid/unsupported
+	// decimal -2147024883 / hex 0x8007000d
+	ErrInvalidData = syscall.Errno(0xd)
+
+	// ErrHandleClose is an error encountered when the handle generating the notification being waited on has been closed
+	ErrHandleClose = errors.New("hcsshim: the handle generating this notification has been closed")
+
+	// ErrAlreadyClosed is an error encountered when using a handle that has been closed by the Close method
+	ErrAlreadyClosed = errors.New("hcsshim: the handle has already been closed")
+
+	// ErrInvalidNotificationType is an error encountered when an invalid notification type is used
+	ErrInvalidNotificationType = errors.New("hcsshim: invalid notification type")
+
+	// ErrInvalidProcessState is an error encountered when the process is not in a valid state for the requested operation
+	ErrInvalidProcessState = errors.New("the process is in an invalid state for the attempted operation")
+
+	// ErrTimeout is an error encountered when waiting on a notification times out
+	ErrTimeout = errors.New("hcsshim: timeout waiting for notification")
+
+	// ErrUnexpectedContainerExit is the error encountered when a container exits while waiting for
+	// a different expected notification
+	ErrUnexpectedContainerExit = errors.New("unexpected container exit")
+
+	// ErrUnexpectedProcessAbort is the error encountered when communication with the compute service
+	// is lost while waiting for a notification
+	ErrUnexpectedProcessAbort = errors.New("lost communication with compute service")
+
+	// ErrUnexpectedValue is an error encountered when hcs returns an invalid value
+	ErrUnexpectedValue = errors.New("unexpected value returned from hcs")
+
+	// ErrVmcomputeAlreadyStopped is an error encountered when a shutdown or terminate request is made on a stopped container
+	ErrVmcomputeAlreadyStopped = syscall.Errno(0xc0370110)
+
+	// ErrVmcomputeOperationPending is an error encountered when the operation is being completed asynchronously
+	ErrVmcomputeOperationPending = syscall.Errno(0xC0370103)
+
+	// ErrVmcomputeOperationInvalidState is an error encountered when the compute system is not in a valid state for the requested operation
+	ErrVmcomputeOperationInvalidState = syscall.Errno(0xc0370105)
+
+	// ErrProcNotFound is an error encountered when the the process cannot be found
+	ErrProcNotFound = syscall.Errno(0x7f)
+
+	// ErrVmcomputeOperationAccessIsDenied is an error which can be encountered when enumerating compute systems in RS1/RS2
+	// builds when the underlying silo might be in the process of terminating. HCS was fixed in RS3.
+	ErrVmcomputeOperationAccessIsDenied = syscall.Errno(0x5)
+
+	// ErrVmcomputeInvalidJSON is an error encountered when the compute system does not support/understand the messages sent by management
+	ErrVmcomputeInvalidJSON = syscall.Errno(0xc037010d)
+
+	// ErrVmcomputeUnknownMessage is an error encountered guest compute system doesn't support the message
+	ErrVmcomputeUnknownMessage = syscall.Errno(0xc037010b)
+
+	// ErrVmcomputeUnexpectedExit is an error encountered when the compute system terminates unexpectedly
+	ErrVmcomputeUnexpectedExit = syscall.Errno(0xC0370106)
+
+	// ErrNotSupported is an error encountered when hcs doesn't support the request
+	ErrPlatformNotSupported = errors.New("unsupported platform request")
+)
+
+type ErrorEvent struct {
+	Message    string `json:"Message,omitempty"`    // Fully formated error message
+	StackTrace string `json:"StackTrace,omitempty"` // Stack trace in string form
+	Provider   string `json:"Provider,omitempty"`
+	EventID    uint16 `json:"EventId,omitempty"`
+	Flags      uint32 `json:"Flags,omitempty"`
+	Source     string `json:"Source,omitempty"`
+	//Data       []EventData `json:"Data,omitempty"`  // Omit this as HCS doesn't encode this well. It's more confusing to include. It is however logged in debug mode (see processHcsResult function)
+}
+
+type hcsResult struct {
+	Error        int32
+	ErrorMessage string
+	ErrorEvents  []ErrorEvent `json:"ErrorEvents,omitempty"`
+}
+
+func (ev *ErrorEvent) String() string {
+	evs := "[Event Detail: " + ev.Message
+	if ev.StackTrace != "" {
+		evs += " Stack Trace: " + ev.StackTrace
+	}
+	if ev.Provider != "" {
+		evs += " Provider: " + ev.Provider
+	}
+	if ev.EventID != 0 {
+		evs = fmt.Sprintf("%s EventID: %d", evs, ev.EventID)
+	}
+	if ev.Flags != 0 {
+		evs = fmt.Sprintf("%s flags: %d", evs, ev.Flags)
+	}
+	if ev.Source != "" {
+		evs += " Source: " + ev.Source
+	}
+	evs += "]"
+	return evs
+}
+
+func processHcsResult(resultp *uint16) []ErrorEvent {
+	if resultp != nil {
+		resultj := interop.ConvertAndFreeCoTaskMemString(resultp)
+		logrus.WithField(logfields.JSON, resultj).
+			Debug("HCS Result")
+		result := &hcsResult{}
+		if err := json.Unmarshal([]byte(resultj), result); err != nil {
+			logrus.WithFields(logrus.Fields{
+				logfields.JSON:  resultj,
+				logrus.ErrorKey: err,
+			}).Warning("Could not unmarshal HCS result")
+			return nil
+		}
+		return result.ErrorEvents
+	}
+	return nil
+}
+
+type HcsError struct {
+	Op     string
+	Err    error
+	Events []ErrorEvent
+}
+
+func (e *HcsError) Error() string {
+	s := e.Op + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+// ProcessError is an error encountered in HCS during an operation on a Process object
+type ProcessError struct {
+	SystemID string
+	Pid      int
+	Op       string
+	Err      error
+	Events   []ErrorEvent
+}
+
+// SystemError is an error encountered in HCS during an operation on a Container object
+type SystemError struct {
+	ID     string
+	Op     string
+	Err    error
+	Extra  string
+	Events []ErrorEvent
+}
+
+func (e *SystemError) Error() string {
+	s := e.Op + " " + e.ID + ": " + e.Err.Error()
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	if e.Extra != "" {
+		s += "\n(extra info: " + e.Extra + ")"
+	}
+	return s
+}
+
+func makeSystemError(system *System, op string, extra string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*SystemError); ok {
+		return err
+	}
+	return &SystemError{
+		ID:     system.ID(),
+		Op:     op,
+		Extra:  extra,
+		Err:    err,
+		Events: events,
+	}
+}
+
+func (e *ProcessError) Error() string {
+	s := fmt.Sprintf("%s %s:%d: %s", e.Op, e.SystemID, e.Pid, e.Err.Error())
+	for _, ev := range e.Events {
+		s += "\n" + ev.String()
+	}
+	return s
+}
+
+func makeProcessError(process *Process, op string, err error, events []ErrorEvent) error {
+	// Don't double wrap errors
+	if _, ok := err.(*ProcessError); ok {
+		return err
+	}
+	return &ProcessError{
+		Pid:      process.Pid(),
+		SystemID: process.SystemID(),
+		Op:       op,
+		Err:      err,
+		Events:   events,
+	}
+}
+
+// IsNotExist checks if an error is caused by the Container or Process not existing.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsNotExist(err error) bool {
+	err = getInnerError(err)
+	return err == ErrComputeSystemDoesNotExist ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsAlreadyClosed checks if an error is caused by the Container or Process having been
+// already closed by a call to the Close() method.
+func IsAlreadyClosed(err error) bool {
+	err = getInnerError(err)
+	return err == ErrAlreadyClosed
+}
+
+// IsPending returns a boolean indicating whether the error is that
+// the requested operation is being completed in the background.
+func IsPending(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeOperationPending
+}
+
+// IsTimeout returns a boolean indicating whether the error is caused by
+// a timeout waiting for the operation to complete.
+func IsTimeout(err error) bool {
+	err = getInnerError(err)
+	return err == ErrTimeout
+}
+
+// IsAlreadyStopped returns a boolean indicating whether the error is caused by
+// a Container or Process being already stopped.
+// Note: Currently, ErrElementNotFound can mean that a Process has either
+// already exited, or does not exist. Both IsAlreadyStopped and IsNotExist
+// will currently return true when the error is ErrElementNotFound or ErrProcNotFound.
+func IsAlreadyStopped(err error) bool {
+	err = getInnerError(err)
+	return err == ErrVmcomputeAlreadyStopped ||
+		err == ErrElementNotFound ||
+		err == ErrProcNotFound
+}
+
+// IsNotSupported returns a boolean indicating whether the error is caused by
+// unsupported platform requests
+// Note: Currently Unsupported platform requests can be mean either
+// ErrVmcomputeInvalidJSON, ErrInvalidData, ErrNotSupported or ErrVmcomputeUnknownMessage
+// is thrown from the Platform
+func IsNotSupported(err error) bool {
+	err = getInnerError(err)
+	// If Platform doesn't recognize or support the request sent, below errors are seen
+	return err == ErrVmcomputeInvalidJSON ||
+		err == ErrInvalidData ||
+		err == ErrNotSupported ||
+		err == ErrVmcomputeUnknownMessage
+}
+
+func getInnerError(err error) error {
+	switch pe := err.(type) {
+	case nil:
+		return nil
+	case *HcsError:
+		err = pe.Err
+	case *SystemError:
+		err = pe.Err
+	case *ProcessError:
+		err = pe.Err
+	}
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/hcs.go

@@ -0,0 +1,48 @@
+// Shim for the Host Compute Service (HCS) to manage Windows Server
+// containers and Hyper-V containers.
+
+package hcs
+
+import (
+	"syscall"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hcs.go
+
+//sys hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) = vmcompute.HcsEnumerateComputeSystems?
+//sys hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsCreateComputeSystem?
+//sys hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) = vmcompute.HcsOpenComputeSystem?
+//sys hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) = vmcompute.HcsCloseComputeSystem?
+//sys hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsStartComputeSystem?
+//sys hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsShutdownComputeSystem?
+//sys hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsTerminateComputeSystem?
+//sys hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsPauseComputeSystem?
+//sys hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) = vmcompute.HcsResumeComputeSystem?
+//sys hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetComputeSystemProperties?
+//sys hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) = vmcompute.HcsModifyComputeSystem?
+//sys hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterComputeSystemCallback?
+//sys hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterComputeSystemCallback?
+
+//sys hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsCreateProcess?
+//sys hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) = vmcompute.HcsOpenProcess?
+//sys hcsCloseProcess(process hcsProcess) (hr error) = vmcompute.HcsCloseProcess?
+//sys hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) = vmcompute.HcsTerminateProcess?
+//sys hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) = vmcompute.HcsGetProcessInfo?
+//sys hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) = vmcompute.HcsGetProcessProperties?
+//sys hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) = vmcompute.HcsModifyProcess?
+//sys hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) = vmcompute.HcsGetServiceProperties?
+//sys hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) = vmcompute.HcsRegisterProcessCallback?
+//sys hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) = vmcompute.HcsUnregisterProcessCallback?
+
+type hcsSystem syscall.Handle
+type hcsProcess syscall.Handle
+type hcsCallback syscall.Handle
+
+type hcsProcessInformation struct {
+	ProcessId uint32
+	Reserved  uint32
+	StdInput  syscall.Handle
+	StdOutput syscall.Handle
+	StdError  syscall.Handle
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/log.go

@@ -0,0 +1,20 @@
+package hcs
+
+import "github.com/sirupsen/logrus"
+
+func logOperationBegin(ctx logrus.Fields, msg string) {
+	logrus.WithFields(ctx).Debug(msg)
+}
+
+func logOperationEnd(ctx logrus.Fields, msg string, err error) {
+	// Copy the log and fields first.
+	log := logrus.WithFields(ctx)
+	if err == nil {
+		log.Debug(msg)
+	} else {
+		// Edit only the copied field data to avoid race conditions on the
+		// write.
+		log.Data[logrus.ErrorKey] = err
+		log.Error(msg)
+	}
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/process.go

@@ -0,0 +1,459 @@
+package hcs
+
+import (
+	"encoding/json"
+	"io"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/guestrequest"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/sirupsen/logrus"
+)
+
+// ContainerError is an error encountered in HCS
+type Process struct {
+	handleLock     sync.RWMutex
+	handle         hcsProcess
+	processID      int
+	system         *System
+	cachedPipes    *cachedPipes
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newProcess(process hcsProcess, processID int, computeSystem *System) *Process {
+	return &Process{
+		handle:    process,
+		processID: processID,
+		system:    computeSystem,
+		logctx: logrus.Fields{
+			logfields.ContainerID: computeSystem.ID(),
+			logfields.ProcessID:   processID,
+		},
+	}
+}
+
+type cachedPipes struct {
+	stdIn  syscall.Handle
+	stdOut syscall.Handle
+	stdErr syscall.Handle
+}
+
+type processModifyRequest struct {
+	Operation   string
+	ConsoleSize *consoleSize `json:",omitempty"`
+	CloseHandle *closeHandle `json:",omitempty"`
+}
+
+type consoleSize struct {
+	Height uint16
+	Width  uint16
+}
+
+type closeHandle struct {
+	Handle string
+}
+
+type ProcessStatus struct {
+	ProcessID      uint32
+	Exited         bool
+	ExitCode       uint32
+	LastWaitResult int32
+}
+
+const (
+	stdIn  string = "StdIn"
+	stdOut string = "StdOut"
+	stdErr string = "StdErr"
+)
+
+const (
+	modifyConsoleSize string = "ConsoleSize"
+	modifyCloseHandle string = "CloseHandle"
+)
+
+// Pid returns the process ID of the process within the container.
+func (process *Process) Pid() int {
+	return process.processID
+}
+
+// SystemID returns the ID of the process's compute system.
+func (process *Process) SystemID() string {
+	return process.system.ID()
+}
+
+func (process *Process) logOperationBegin(operation string) {
+	logOperationBegin(
+		process.logctx,
+		operation+" - Begin Operation")
+}
+
+func (process *Process) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		process.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// Signal signals the process with `options`.
+func (process *Process) Signal(options guestrequest.SignalProcessOptions) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Signal"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	optionsb, err := json.Marshal(options)
+	if err != nil {
+		return err
+	}
+
+	optionsStr := string(optionsb)
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsSignalProcess(process.handle, optionsStr, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Kill signals the process to terminate but does not wait for it to finish terminating.
+func (process *Process) Kill() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Kill"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(process.logctx, func() {
+		err = hcsTerminateProcess(process.handle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Wait waits for the process to exit.
+func (process *Process) Wait() (err error) {
+	operation := "hcsshim::Process::Wait"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, nil)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout waits for the process to exit or the duration to elapse. It returns
+// false if timeout occurs.
+func (process *Process) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcssshim::Process::WaitTimeout"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(process.callbackNumber, hcsNotificationProcessExited, &timeout)
+	if err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	return nil
+}
+
+// ResizeConsole resizes the console of the process.
+func (process *Process) ResizeConsole(width, height uint16) (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::ResizeConsole"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyConsoleSize,
+		ConsoleSize: &consoleSize{
+			Height: height,
+			Width:  width,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+func (process *Process) Properties() (_ *ProcessStatus, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Properties"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var (
+		resultp     *uint16
+		propertiesp *uint16
+	)
+	syscallWatcher(process.logctx, func() {
+		err = hcsGetProcessProperties(process.handle, &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeProcessError(process, operation, err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+
+	properties := &ProcessStatus{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return properties, nil
+}
+
+// ExitCode returns the exit code of the process. The process must have
+// already terminated.
+func (process *Process) ExitCode() (_ int, err error) {
+	operation := "hcsshim::Process::ExitCode"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	properties, err := process.Properties()
+	if err != nil {
+		return 0, makeProcessError(process, operation, err, nil)
+	}
+
+	if properties.Exited == false {
+		return 0, makeProcessError(process, operation, ErrInvalidProcessState, nil)
+	}
+
+	if properties.LastWaitResult != 0 {
+		return 0, makeProcessError(process, operation, syscall.Errno(properties.LastWaitResult), nil)
+	}
+
+	return int(properties.ExitCode), nil
+}
+
+// Stdio returns the stdin, stdout, and stderr pipes, respectively. Closing
+// these pipes does not close the underlying pipes; it should be possible to
+// call this multiple times to get multiple interfaces.
+func (process *Process) Stdio() (_ io.WriteCloser, _ io.ReadCloser, _ io.ReadCloser, err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::Stdio"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return nil, nil, nil, makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	var stdIn, stdOut, stdErr syscall.Handle
+
+	if process.cachedPipes == nil {
+		var (
+			processInfo hcsProcessInformation
+			resultp     *uint16
+		)
+		err = hcsGetProcessInfo(process.handle, &processInfo, &resultp)
+		events := processHcsResult(resultp)
+		if err != nil {
+			return nil, nil, nil, makeProcessError(process, operation, err, events)
+		}
+
+		stdIn, stdOut, stdErr = processInfo.StdInput, processInfo.StdOutput, processInfo.StdError
+	} else {
+		// Use cached pipes
+		stdIn, stdOut, stdErr = process.cachedPipes.stdIn, process.cachedPipes.stdOut, process.cachedPipes.stdErr
+
+		// Invalidate the cache
+		process.cachedPipes = nil
+	}
+
+	pipes, err := makeOpenFiles([]syscall.Handle{stdIn, stdOut, stdErr})
+	if err != nil {
+		return nil, nil, nil, makeProcessError(process, operation, err, nil)
+	}
+
+	return pipes[0], pipes[1], pipes[2], nil
+}
+
+// CloseStdin closes the write side of the stdin pipe so that the process is
+// notified on the read side that there is no more data in stdin.
+func (process *Process) CloseStdin() (err error) {
+	process.handleLock.RLock()
+	defer process.handleLock.RUnlock()
+
+	operation := "hcsshim::Process::CloseStdin"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	if process.handle == 0 {
+		return makeProcessError(process, operation, ErrAlreadyClosed, nil)
+	}
+
+	modifyRequest := processModifyRequest{
+		Operation: modifyCloseHandle,
+		CloseHandle: &closeHandle{
+			Handle: stdIn,
+		},
+	}
+
+	modifyRequestb, err := json.Marshal(modifyRequest)
+	if err != nil {
+		return err
+	}
+
+	modifyRequestStr := string(modifyRequestb)
+
+	var resultp *uint16
+	err = hcsModifyProcess(process.handle, modifyRequestStr, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeProcessError(process, operation, err, events)
+	}
+
+	return nil
+}
+
+// Close cleans up any state associated with the process but does not kill
+// or wait on it.
+func (process *Process) Close() (err error) {
+	process.handleLock.Lock()
+	defer process.handleLock.Unlock()
+
+	operation := "hcsshim::Process::Close"
+	process.logOperationBegin(operation)
+	defer func() { process.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if process.handle == 0 {
+		return nil
+	}
+
+	if err = process.unregisterCallback(); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	if err = hcsCloseProcess(process.handle); err != nil {
+		return makeProcessError(process, operation, err, nil)
+	}
+
+	process.handle = 0
+
+	return nil
+}
+
+func (process *Process) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterProcessCallback(process.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	process.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (process *Process) unregisterCallback() error {
+	callbackNumber := process.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterProcessCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterProcessCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/system.go

@@ -0,0 +1,685 @@
+package hcs
+
+import (
+	"encoding/json"
+	"os"
+	"strconv"
+	"sync"
+	"syscall"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/schema1"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// currentContainerStarts is used to limit the number of concurrent container
+// starts.
+var currentContainerStarts containerStarts
+
+type containerStarts struct {
+	maxParallel int
+	inProgress  int
+	sync.Mutex
+}
+
+func init() {
+	mpsS := os.Getenv("HCSSHIM_MAX_PARALLEL_START")
+	if len(mpsS) > 0 {
+		mpsI, err := strconv.Atoi(mpsS)
+		if err != nil || mpsI < 0 {
+			return
+		}
+		currentContainerStarts.maxParallel = mpsI
+	}
+}
+
+type System struct {
+	handleLock     sync.RWMutex
+	handle         hcsSystem
+	id             string
+	callbackNumber uintptr
+
+	logctx logrus.Fields
+}
+
+func newSystem(id string) *System {
+	return &System{
+		id: id,
+		logctx: logrus.Fields{
+			logfields.ContainerID: id,
+		},
+	}
+}
+
+func (computeSystem *System) logOperationBegin(operation string) {
+	logOperationBegin(
+		computeSystem.logctx,
+		operation+" - Begin Operation")
+}
+
+func (computeSystem *System) logOperationEnd(operation string, err error) {
+	var result string
+	if err == nil {
+		result = "Success"
+	} else {
+		result = "Error"
+	}
+
+	logOperationEnd(
+		computeSystem.logctx,
+		operation+" - End Operation - "+result,
+		err)
+}
+
+// CreateComputeSystem creates a new compute system with the given configuration but does not start it.
+func CreateComputeSystem(id string, hcsDocumentInterface interface{}) (_ *System, err error) {
+	operation := "hcsshim::CreateComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	hcsDocumentB, err := json.Marshal(hcsDocumentInterface)
+	if err != nil {
+		return nil, err
+	}
+
+	hcsDocument := string(hcsDocumentB)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, hcsDocument).
+		Debug("HCS ComputeSystem Document")
+
+	var (
+		resultp     *uint16
+		identity    syscall.Handle
+		createError error
+	)
+	syscallWatcher(computeSystem.logctx, func() {
+		createError = hcsCreateComputeSystem(id, hcsDocument, identity, &computeSystem.handle, &resultp)
+	})
+
+	if createError == nil || IsPending(createError) {
+		if err = computeSystem.registerCallback(); err != nil {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+			return nil, makeSystemError(computeSystem, operation, "", err, nil)
+		}
+	}
+
+	events, err := processAsyncHcsResult(createError, resultp, computeSystem.callbackNumber, hcsNotificationSystemCreateCompleted, &timeout.SystemCreate)
+	if err != nil {
+		if err == ErrTimeout {
+			// Terminate the compute system if it still exists. We're okay to
+			// ignore a failure here.
+			computeSystem.Terminate()
+		}
+		return nil, makeSystemError(computeSystem, operation, hcsDocument, err, events)
+	}
+
+	return computeSystem, nil
+}
+
+// OpenComputeSystem opens an existing compute system by ID.
+func OpenComputeSystem(id string) (_ *System, err error) {
+	operation := "hcsshim::OpenComputeSystem"
+
+	computeSystem := newSystem(id)
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsNotExist(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	var (
+		handle  hcsSystem
+		resultp *uint16
+	)
+	err = hcsOpenComputeSystem(id, &handle, &resultp)
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, events)
+	}
+
+	computeSystem.handle = handle
+
+	if err = computeSystem.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, operation, "", err, nil)
+	}
+
+	return computeSystem, nil
+}
+
+// GetComputeSystems gets a list of the compute systems on the system that match the query
+func GetComputeSystems(q schema1.ComputeSystemQuery) (_ []schema1.ContainerProperties, err error) {
+	operation := "hcsshim::GetComputeSystems"
+	fields := logrus.Fields{}
+	logOperationBegin(
+		fields,
+		operation+" - Begin Operation")
+
+	defer func() {
+		var result string
+		if err == nil {
+			result = "Success"
+		} else {
+			result = "Error"
+		}
+
+		logOperationEnd(
+			fields,
+			operation+" - End Operation - "+result,
+			err)
+	}()
+
+	queryb, err := json.Marshal(q)
+	if err != nil {
+		return nil, err
+	}
+
+	query := string(queryb)
+
+	logrus.WithFields(fields).
+		WithField(logfields.JSON, query).
+		Debug("HCS ComputeSystem Query")
+
+	var (
+		resultp         *uint16
+		computeSystemsp *uint16
+	)
+
+	syscallWatcher(fields, func() {
+		err = hcsEnumerateComputeSystems(query, &computeSystemsp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, &HcsError{Op: operation, Err: err, Events: events}
+	}
+
+	if computeSystemsp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	computeSystemsRaw := interop.ConvertAndFreeCoTaskMemBytes(computeSystemsp)
+	computeSystems := []schema1.ContainerProperties{}
+	if err = json.Unmarshal(computeSystemsRaw, &computeSystems); err != nil {
+		return nil, err
+	}
+
+	return computeSystems, nil
+}
+
+// Start synchronously starts the computeSystem.
+func (computeSystem *System) Start() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Start"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Start", "", ErrAlreadyClosed, nil)
+	}
+
+	// This is a very simple backoff-retry loop to limit the number
+	// of parallel container starts if environment variable
+	// HCSSHIM_MAX_PARALLEL_START is set to a positive integer.
+	// It should generally only be used as a workaround to various
+	// platform issues that exist between RS1 and RS4 as of Aug 2018
+	if currentContainerStarts.maxParallel > 0 {
+		for {
+			currentContainerStarts.Lock()
+			if currentContainerStarts.inProgress < currentContainerStarts.maxParallel {
+				currentContainerStarts.inProgress++
+				currentContainerStarts.Unlock()
+				break
+			}
+			if currentContainerStarts.inProgress == currentContainerStarts.maxParallel {
+				currentContainerStarts.Unlock()
+				time.Sleep(100 * time.Millisecond)
+			}
+		}
+		// Make sure we decrement the count when we are done.
+		defer func() {
+			currentContainerStarts.Lock()
+			currentContainerStarts.inProgress--
+			currentContainerStarts.Unlock()
+		}()
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsStartComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemStartCompleted, &timeout.SystemStart)
+	if err != nil {
+		return makeSystemError(computeSystem, "Start", "", err, events)
+	}
+
+	return nil
+}
+
+// ID returns the compute system's identifier.
+func (computeSystem *System) ID() string {
+	return computeSystem.id
+}
+
+// Shutdown requests a compute system shutdown, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Shutdown() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Shutdown"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsAlreadyStopped(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Shutdown", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsShutdownComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Shutdown", "", err, events)
+	}
+
+	return nil
+}
+
+// Terminate requests a compute system terminate, if IsPending() on the error returned is true,
+// it may not actually be shut down until Wait() succeeds.
+func (computeSystem *System) Terminate() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Terminate"
+	computeSystem.logOperationBegin(operation)
+	defer func() {
+		if IsPending(err) {
+			computeSystem.logOperationEnd(operation, nil)
+		} else {
+			computeSystem.logOperationEnd(operation, err)
+		}
+	}()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Terminate", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsTerminateComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil && err != ErrVmcomputeAlreadyStopped {
+		return makeSystemError(computeSystem, "Terminate", "", err, events)
+	}
+
+	return nil
+}
+
+// Wait synchronously waits for the compute system to shutdown or terminate.
+func (computeSystem *System) Wait() (err error) {
+	operation := "hcsshim::ComputeSystem::Wait"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil {
+		return makeSystemError(computeSystem, "Wait", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitExpectedError synchronously waits for the compute system to shutdown or
+// terminate, and ignores the passed error if it occurs.
+func (computeSystem *System) WaitExpectedError(expected error) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitExpectedError"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, nil)
+	if err != nil && getInnerError(err) != expected {
+		return makeSystemError(computeSystem, "WaitExpectedError", "", err, nil)
+	}
+
+	return nil
+}
+
+// WaitTimeout synchronously waits for the compute system to terminate or the duration to elapse.
+// If the timeout expires, IsTimeout(err) == true
+func (computeSystem *System) WaitTimeout(timeout time.Duration) (err error) {
+	operation := "hcsshim::ComputeSystem::WaitTimeout"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	err = waitForNotification(computeSystem.callbackNumber, hcsNotificationSystemExited, &timeout)
+	if err != nil {
+		return makeSystemError(computeSystem, "WaitTimeout", "", err, nil)
+	}
+
+	return nil
+}
+
+func (computeSystem *System) Properties(types ...schema1.PropertyType) (_ *schema1.ContainerProperties, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Properties"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	queryj, err := json.Marshal(schema1.PropertyQuery{types})
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, queryj).
+		Debug("HCS ComputeSystem Properties Query")
+
+	var resultp, propertiesp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsGetComputeSystemProperties(computeSystem.handle, string(queryj), &propertiesp, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, events)
+	}
+
+	if propertiesp == nil {
+		return nil, ErrUnexpectedValue
+	}
+	propertiesRaw := interop.ConvertAndFreeCoTaskMemBytes(propertiesp)
+	properties := &schema1.ContainerProperties{}
+	if err := json.Unmarshal(propertiesRaw, properties); err != nil {
+		return nil, makeSystemError(computeSystem, "Properties", "", err, nil)
+	}
+
+	return properties, nil
+}
+
+// Pause pauses the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Pause() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Pause"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Pause", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsPauseComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemPauseCompleted, &timeout.SystemPause)
+	if err != nil {
+		return makeSystemError(computeSystem, "Pause", "", err, events)
+	}
+
+	return nil
+}
+
+// Resume resumes the execution of the computeSystem. This feature is not enabled in TP5.
+func (computeSystem *System) Resume() (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Resume"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Resume", "", ErrAlreadyClosed, nil)
+	}
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsResumeComputeSystem(computeSystem.handle, "", &resultp)
+	})
+	events, err := processAsyncHcsResult(err, resultp, computeSystem.callbackNumber, hcsNotificationSystemResumeCompleted, &timeout.SystemResume)
+	if err != nil {
+		return makeSystemError(computeSystem, "Resume", "", err, events)
+	}
+
+	return nil
+}
+
+// CreateProcess launches a new process within the computeSystem.
+func (computeSystem *System) CreateProcess(c interface{}) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::CreateProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processInfo   hcsProcessInformation
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	configurationb, err := json.Marshal(c)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	configuration := string(configurationb)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, configuration).
+		Debug("HCS ComputeSystem Process Document")
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCreateProcess(computeSystem.handle, configuration, &processInfo, &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", configuration, err, events)
+	}
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.ProcessID, processInfo.ProcessId).
+		Debug("HCS ComputeSystem CreateProcess PID")
+
+	process := newProcess(processHandle, int(processInfo.ProcessId), computeSystem)
+	process.cachedPipes = &cachedPipes{
+		stdIn:  processInfo.StdInput,
+		stdOut: processInfo.StdOutput,
+		stdErr: processInfo.StdError,
+	}
+
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "CreateProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// OpenProcess gets an interface to an existing process within the computeSystem.
+func (computeSystem *System) OpenProcess(pid int) (_ *Process, err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	// Add PID for the context of this operation
+	computeSystem.logctx[logfields.ProcessID] = pid
+	defer delete(computeSystem.logctx, logfields.ProcessID)
+
+	operation := "hcsshim::ComputeSystem::OpenProcess"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	var (
+		processHandle hcsProcess
+		resultp       *uint16
+	)
+
+	if computeSystem.handle == 0 {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", ErrAlreadyClosed, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsOpenProcess(computeSystem.handle, uint32(pid), &processHandle, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, events)
+	}
+
+	process := newProcess(processHandle, pid, computeSystem)
+	if err = process.registerCallback(); err != nil {
+		return nil, makeSystemError(computeSystem, "OpenProcess", "", err, nil)
+	}
+
+	return process, nil
+}
+
+// Close cleans up any state associated with the compute system but does not terminate or wait for it.
+func (computeSystem *System) Close() (err error) {
+	computeSystem.handleLock.Lock()
+	defer computeSystem.handleLock.Unlock()
+
+	operation := "hcsshim::ComputeSystem::Close"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	// Don't double free this
+	if computeSystem.handle == 0 {
+		return nil
+	}
+
+	if err = computeSystem.unregisterCallback(); err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsCloseComputeSystem(computeSystem.handle)
+	})
+	if err != nil {
+		return makeSystemError(computeSystem, "Close", "", err, nil)
+	}
+
+	computeSystem.handle = 0
+
+	return nil
+}
+
+func (computeSystem *System) registerCallback() error {
+	context := &notifcationWatcherContext{
+		channels: newChannels(),
+	}
+
+	callbackMapLock.Lock()
+	callbackNumber := nextCallback
+	nextCallback++
+	callbackMap[callbackNumber] = context
+	callbackMapLock.Unlock()
+
+	var callbackHandle hcsCallback
+	err := hcsRegisterComputeSystemCallback(computeSystem.handle, notificationWatcherCallback, callbackNumber, &callbackHandle)
+	if err != nil {
+		return err
+	}
+	context.handle = callbackHandle
+	computeSystem.callbackNumber = callbackNumber
+
+	return nil
+}
+
+func (computeSystem *System) unregisterCallback() error {
+	callbackNumber := computeSystem.callbackNumber
+
+	callbackMapLock.RLock()
+	context := callbackMap[callbackNumber]
+	callbackMapLock.RUnlock()
+
+	if context == nil {
+		return nil
+	}
+
+	handle := context.handle
+
+	if handle == 0 {
+		return nil
+	}
+
+	// hcsUnregisterComputeSystemCallback has its own syncronization
+	// to wait for all callbacks to complete. We must NOT hold the callbackMapLock.
+	err := hcsUnregisterComputeSystemCallback(handle)
+	if err != nil {
+		return err
+	}
+
+	closeChannels(context.channels)
+
+	callbackMapLock.Lock()
+	callbackMap[callbackNumber] = nil
+	callbackMapLock.Unlock()
+
+	handle = 0
+
+	return nil
+}
+
+// Modify the System by sending a request to HCS
+func (computeSystem *System) Modify(config interface{}) (err error) {
+	computeSystem.handleLock.RLock()
+	defer computeSystem.handleLock.RUnlock()
+
+	operation := "hcsshim::ComputeSystem::Modify"
+	computeSystem.logOperationBegin(operation)
+	defer func() { computeSystem.logOperationEnd(operation, err) }()
+
+	if computeSystem.handle == 0 {
+		return makeSystemError(computeSystem, "Modify", "", ErrAlreadyClosed, nil)
+	}
+
+	requestJSON, err := json.Marshal(config)
+	if err != nil {
+		return err
+	}
+
+	requestString := string(requestJSON)
+
+	logrus.WithFields(computeSystem.logctx).
+		WithField(logfields.JSON, requestString).
+		Debug("HCS ComputeSystem Modify Document")
+
+	var resultp *uint16
+	syscallWatcher(computeSystem.logctx, func() {
+		err = hcsModifyComputeSystem(computeSystem.handle, requestString, &resultp)
+	})
+	events := processHcsResult(resultp)
+	if err != nil {
+		return makeSystemError(computeSystem, "Modify", requestString, err, events)
+	}
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/utils.go

@@ -0,0 +1,33 @@
+package hcs
+
+import (
+	"io"
+	"syscall"
+
+	"github.com/Microsoft/go-winio"
+)
+
+// makeOpenFiles calls winio.MakeOpenFile for each handle in a slice but closes all the handles
+// if there is an error.
+func makeOpenFiles(hs []syscall.Handle) (_ []io.ReadWriteCloser, err error) {
+	fs := make([]io.ReadWriteCloser, len(hs))
+	for i, h := range hs {
+		if h != syscall.Handle(0) {
+			if err == nil {
+				fs[i], err = winio.MakeOpenFile(h)
+			}
+			if err != nil {
+				syscall.Close(h)
+			}
+		}
+	}
+	if err != nil {
+		for _, f := range fs {
+			if f != nil {
+				f.Close()
+			}
+		}
+		return nil, err
+	}
+	return fs, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/waithelper.go

@@ -0,0 +1,63 @@
+package hcs
+
+import (
+	"time"
+
+	"github.com/sirupsen/logrus"
+)
+
+func processAsyncHcsResult(err error, resultp *uint16, callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) ([]ErrorEvent, error) {
+	events := processHcsResult(resultp)
+	if IsPending(err) {
+		return nil, waitForNotification(callbackNumber, expectedNotification, timeout)
+	}
+
+	return events, err
+}
+
+func waitForNotification(callbackNumber uintptr, expectedNotification hcsNotification, timeout *time.Duration) error {
+	callbackMapLock.RLock()
+	channels := callbackMap[callbackNumber].channels
+	callbackMapLock.RUnlock()
+
+	expectedChannel := channels[expectedNotification]
+	if expectedChannel == nil {
+		logrus.Errorf("unknown notification type in waitForNotification %x", expectedNotification)
+		return ErrInvalidNotificationType
+	}
+
+	var c <-chan time.Time
+	if timeout != nil {
+		timer := time.NewTimer(*timeout)
+		c = timer.C
+		defer timer.Stop()
+	}
+
+	select {
+	case err, ok := <-expectedChannel:
+		if !ok {
+			return ErrHandleClose
+		}
+		return err
+	case err, ok := <-channels[hcsNotificationSystemExited]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// If the expected notification is hcsNotificationSystemExited which of the two selects
+		// chosen is random. Return the raw error if hcsNotificationSystemExited is expected
+		if channels[hcsNotificationSystemExited] == expectedChannel {
+			return err
+		}
+		return ErrUnexpectedContainerExit
+	case _, ok := <-channels[hcsNotificationServiceDisconnect]:
+		if !ok {
+			return ErrHandleClose
+		}
+		// hcsNotificationServiceDisconnect should never be an expected notification
+		// it does not need the same handling as hcsNotificationSystemExited
+		return ErrUnexpectedProcessAbort
+	case <-c:
+		return ErrTimeout
+	}
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/watcher.go

@@ -0,0 +1,41 @@
+package hcs
+
+import (
+	"context"
+
+	"github.com/Microsoft/hcsshim/internal/logfields"
+	"github.com/Microsoft/hcsshim/internal/timeout"
+	"github.com/sirupsen/logrus"
+)
+
+// syscallWatcher is used as a very simple goroutine around calls into
+// the platform. In some cases, we have seen HCS APIs not returning due to
+// various bugs, and the goroutine making the syscall ends up not returning,
+// prior to its async callback. By spinning up a syscallWatcher, it allows
+// us to at least log a warning if a syscall doesn't complete in a reasonable
+// amount of time.
+//
+// Usage is:
+//
+// syscallWatcher(logContext, func() {
+//    err = <syscall>(args...)
+// })
+//
+
+func syscallWatcher(logContext logrus.Fields, syscallLambda func()) {
+	ctx, cancel := context.WithTimeout(context.Background(), timeout.SyscallWatcher)
+	defer cancel()
+	go watchFunc(ctx, logContext)
+	syscallLambda()
+}
+
+func watchFunc(ctx context.Context, logContext logrus.Fields) {
+	select {
+	case <-ctx.Done():
+		if ctx.Err() != context.Canceled {
+			logrus.WithFields(logContext).
+				WithField(logfields.Timeout, timeout.SyscallWatcher).
+				Warning("Syscall did not complete within operation timeout. This may indicate a platform issue. If it appears to be making no forward progress, obtain the stacks and see if there is a syscall stuck in the platform API for a significant length of time.")
+		}
+	}
+}

vendor/github.com/Microsoft/hcsshim/internal/hcs/zsyscall_windows.go

@@ -0,0 +1,533 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hcs
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHcsEnumerateComputeSystems         = modvmcompute.NewProc("HcsEnumerateComputeSystems")
+	procHcsCreateComputeSystem             = modvmcompute.NewProc("HcsCreateComputeSystem")
+	procHcsOpenComputeSystem               = modvmcompute.NewProc("HcsOpenComputeSystem")
+	procHcsCloseComputeSystem              = modvmcompute.NewProc("HcsCloseComputeSystem")
+	procHcsStartComputeSystem              = modvmcompute.NewProc("HcsStartComputeSystem")
+	procHcsShutdownComputeSystem           = modvmcompute.NewProc("HcsShutdownComputeSystem")
+	procHcsTerminateComputeSystem          = modvmcompute.NewProc("HcsTerminateComputeSystem")
+	procHcsPauseComputeSystem              = modvmcompute.NewProc("HcsPauseComputeSystem")
+	procHcsResumeComputeSystem             = modvmcompute.NewProc("HcsResumeComputeSystem")
+	procHcsGetComputeSystemProperties      = modvmcompute.NewProc("HcsGetComputeSystemProperties")
+	procHcsModifyComputeSystem             = modvmcompute.NewProc("HcsModifyComputeSystem")
+	procHcsRegisterComputeSystemCallback   = modvmcompute.NewProc("HcsRegisterComputeSystemCallback")
+	procHcsUnregisterComputeSystemCallback = modvmcompute.NewProc("HcsUnregisterComputeSystemCallback")
+	procHcsCreateProcess                   = modvmcompute.NewProc("HcsCreateProcess")
+	procHcsOpenProcess                     = modvmcompute.NewProc("HcsOpenProcess")
+	procHcsCloseProcess                    = modvmcompute.NewProc("HcsCloseProcess")
+	procHcsTerminateProcess                = modvmcompute.NewProc("HcsTerminateProcess")
+
+	procHcsGetProcessInfo            = modvmcompute.NewProc("HcsGetProcessInfo")
+	procHcsGetProcessProperties      = modvmcompute.NewProc("HcsGetProcessProperties")
+	procHcsModifyProcess             = modvmcompute.NewProc("HcsModifyProcess")
+	procHcsGetServiceProperties      = modvmcompute.NewProc("HcsGetServiceProperties")
+	procHcsRegisterProcessCallback   = modvmcompute.NewProc("HcsRegisterProcessCallback")
+	procHcsUnregisterProcessCallback = modvmcompute.NewProc("HcsUnregisterProcessCallback")
+)
+
+func hcsEnumerateComputeSystems(query string, computeSystems **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(query)
+	if hr != nil {
+		return
+	}
+	return _hcsEnumerateComputeSystems(_p0, computeSystems, result)
+}
+
+func _hcsEnumerateComputeSystems(query *uint16, computeSystems **uint16, result **uint16) (hr error) {
+	if hr = procHcsEnumerateComputeSystems.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsEnumerateComputeSystems.Addr(), 3, uintptr(unsafe.Pointer(query)), uintptr(unsafe.Pointer(computeSystems)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateComputeSystem(id string, configuration string, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateComputeSystem(_p0, _p1, identity, computeSystem, result)
+}
+
+func _hcsCreateComputeSystem(id *uint16, configuration *uint16, identity syscall.Handle, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsCreateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateComputeSystem.Addr(), 5, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(configuration)), uintptr(identity), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenComputeSystem(id string, computeSystem *hcsSystem, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(id)
+	if hr != nil {
+		return
+	}
+	return _hcsOpenComputeSystem(_p0, computeSystem, result)
+}
+
+func _hcsOpenComputeSystem(id *uint16, computeSystem *hcsSystem, result **uint16) (hr error) {
+	if hr = procHcsOpenComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsOpenComputeSystem.Addr(), 3, uintptr(unsafe.Pointer(id)), uintptr(unsafe.Pointer(computeSystem)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseComputeSystem(computeSystem hcsSystem) (hr error) {
+	if hr = procHcsCloseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseComputeSystem.Addr(), 1, uintptr(computeSystem), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsStartComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsStartComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsStartComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsStartComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsStartComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsShutdownComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsShutdownComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsShutdownComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsShutdownComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsShutdownComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsTerminateComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsTerminateComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsPauseComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsPauseComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsPauseComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsPauseComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsPauseComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsResumeComputeSystem(computeSystem hcsSystem, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsResumeComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsResumeComputeSystem(computeSystem hcsSystem, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsResumeComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsResumeComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetComputeSystemProperties(computeSystem, _p0, properties, result)
+}
+
+func _hcsGetComputeSystemProperties(computeSystem hcsSystem, propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetComputeSystemProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsGetComputeSystemProperties.Addr(), 4, uintptr(computeSystem), uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyComputeSystem(computeSystem hcsSystem, configuration string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(configuration)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyComputeSystem(computeSystem, _p0, result)
+}
+
+func _hcsModifyComputeSystem(computeSystem hcsSystem, configuration *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyComputeSystem.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyComputeSystem.Addr(), 3, uintptr(computeSystem), uintptr(unsafe.Pointer(configuration)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterComputeSystemCallback(computeSystem hcsSystem, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterComputeSystemCallback.Addr(), 4, uintptr(computeSystem), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterComputeSystemCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterComputeSystemCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterComputeSystemCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCreateProcess(computeSystem hcsSystem, processParameters string, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(processParameters)
+	if hr != nil {
+		return
+	}
+	return _hcsCreateProcess(computeSystem, _p0, processInformation, process, result)
+}
+
+func _hcsCreateProcess(computeSystem hcsSystem, processParameters *uint16, processInformation *hcsProcessInformation, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsCreateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsCreateProcess.Addr(), 5, uintptr(computeSystem), uintptr(unsafe.Pointer(processParameters)), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsOpenProcess(computeSystem hcsSystem, pid uint32, process *hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsOpenProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsOpenProcess.Addr(), 4, uintptr(computeSystem), uintptr(pid), uintptr(unsafe.Pointer(process)), uintptr(unsafe.Pointer(result)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsCloseProcess(process hcsProcess) (hr error) {
+	if hr = procHcsCloseProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsCloseProcess.Addr(), 1, uintptr(process), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsTerminateProcess(process hcsProcess, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 2, uintptr(process), uintptr(unsafe.Pointer(result)), 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsSignalProcess(process hcsProcess, options string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(options)
+	if hr != nil {
+		return
+	}
+	return _hcsSignalProcess(process, _p0, result)
+}
+
+func _hcsSignalProcess(process hcsProcess, options *uint16, result **uint16) (hr error) {
+	if hr = procHcsTerminateProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsTerminateProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(options)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessInfo(process hcsProcess, processInformation *hcsProcessInformation, result **uint16) (hr error) {
+	if hr = procHcsGetProcessInfo.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessInfo.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processInformation)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetProcessProperties(process hcsProcess, processProperties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetProcessProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetProcessProperties.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(processProperties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsModifyProcess(process hcsProcess, settings string, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(settings)
+	if hr != nil {
+		return
+	}
+	return _hcsModifyProcess(process, _p0, result)
+}
+
+func _hcsModifyProcess(process hcsProcess, settings *uint16, result **uint16) (hr error) {
+	if hr = procHcsModifyProcess.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsModifyProcess.Addr(), 3, uintptr(process), uintptr(unsafe.Pointer(settings)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsGetServiceProperties(propertyQuery string, properties **uint16, result **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(propertyQuery)
+	if hr != nil {
+		return
+	}
+	return _hcsGetServiceProperties(_p0, properties, result)
+}
+
+func _hcsGetServiceProperties(propertyQuery *uint16, properties **uint16, result **uint16) (hr error) {
+	if hr = procHcsGetServiceProperties.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsGetServiceProperties.Addr(), 3, uintptr(unsafe.Pointer(propertyQuery)), uintptr(unsafe.Pointer(properties)), uintptr(unsafe.Pointer(result)))
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsRegisterProcessCallback(process hcsProcess, callback uintptr, context uintptr, callbackHandle *hcsCallback) (hr error) {
+	if hr = procHcsRegisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHcsRegisterProcessCallback.Addr(), 4, uintptr(process), uintptr(callback), uintptr(context), uintptr(unsafe.Pointer(callbackHandle)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}
+
+func hcsUnregisterProcessCallback(callbackHandle hcsCallback) (hr error) {
+	if hr = procHcsUnregisterProcessCallback.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall(procHcsUnregisterProcessCallback.Addr(), 1, uintptr(callbackHandle), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/hcserror/hcserror.go

@@ -0,0 +1,47 @@
+package hcserror
+
+import (
+	"fmt"
+	"syscall"
+)
+
+const ERROR_GEN_FAILURE = syscall.Errno(31)
+
+type HcsError struct {
+	title string
+	rest  string
+	Err   error
+}
+
+func (e *HcsError) Error() string {
+	s := e.title
+	if len(s) > 0 && s[len(s)-1] != ' ' {
+		s += " "
+	}
+	s += fmt.Sprintf("failed in Win32: %s (0x%x)", e.Err, Win32FromError(e.Err))
+	if e.rest != "" {
+		if e.rest[0] != ' ' {
+			s += " "
+		}
+		s += e.rest
+	}
+	return s
+}
+
+func New(err error, title, rest string) error {
+	// Pass through DLL errors directly since they do not originate from HCS.
+	if _, ok := err.(*syscall.DLLError); ok {
+		return err
+	}
+	return &HcsError{title, rest, err}
+}
+
+func Win32FromError(err error) uint32 {
+	if herr, ok := err.(*HcsError); ok {
+		return Win32FromError(herr.Err)
+	}
+	if code, ok := err.(syscall.Errno); ok {
+		return uint32(code)
+	}
+	return uint32(ERROR_GEN_FAILURE)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hns.go

@@ -0,0 +1,23 @@
+package hns
+
+import "fmt"
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go hns.go
+
+//sys _hnsCall(method string, path string, object string, response **uint16) (hr error) = vmcompute.HNSCall?
+
+type EndpointNotFoundError struct {
+	EndpointName string
+}
+
+func (e EndpointNotFoundError) Error() string {
+	return fmt.Sprintf("Endpoint %s not found", e.EndpointName)
+}
+
+type NetworkNotFoundError struct {
+	NetworkName string
+}
+
+func (e NetworkNotFoundError) Error() string {
+	return fmt.Sprintf("Network %s not found", e.NetworkName)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsendpoint.go

@@ -0,0 +1,262 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// HNSEndpoint represents a network endpoint in HNS
+type HNSEndpoint struct {
+	Id                 string            `json:"ID,omitempty"`
+	Name               string            `json:",omitempty"`
+	VirtualNetwork     string            `json:",omitempty"`
+	VirtualNetworkName string            `json:",omitempty"`
+	Policies           []json.RawMessage `json:",omitempty"`
+	MacAddress         string            `json:",omitempty"`
+	IPAddress          net.IP            `json:",omitempty"`
+	DNSSuffix          string            `json:",omitempty"`
+	DNSServerList      string            `json:",omitempty"`
+	GatewayAddress     string            `json:",omitempty"`
+	EnableInternalDNS  bool              `json:",omitempty"`
+	DisableICC         bool              `json:",omitempty"`
+	PrefixLength       uint8             `json:",omitempty"`
+	IsRemoteEndpoint   bool              `json:",omitempty"`
+	EnableLowMetric    bool              `json:",omitempty"`
+	Namespace          *Namespace        `json:",omitempty"`
+	EncapOverhead      uint16            `json:",omitempty"`
+}
+
+//SystemType represents the type of the system on which actions are done
+type SystemType string
+
+// SystemType const
+const (
+	ContainerType      SystemType = "Container"
+	VirtualMachineType SystemType = "VirtualMachine"
+	HostType           SystemType = "Host"
+)
+
+// EndpointAttachDetachRequest is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type EndpointAttachDetachRequest struct {
+	ContainerID    string     `json:"ContainerId,omitempty"`
+	SystemType     SystemType `json:"SystemType"`
+	CompartmentID  uint16     `json:"CompartmentId,omitempty"`
+	VirtualNICName string     `json:"VirtualNicName,omitempty"`
+}
+
+// EndpointResquestResponse is object to get the endpoint request response
+type EndpointResquestResponse struct {
+	Success bool
+	Error   string
+}
+
+// HNSEndpointRequest makes a HNS call to modify/query a network endpoint
+func HNSEndpointRequest(method, path, request string) (*HNSEndpoint, error) {
+	endpoint := &HNSEndpoint{}
+	err := hnsCall(method, "/endpoints/"+path, request, &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// HNSListEndpointRequest makes a HNS call to query the list of available endpoints
+func HNSListEndpointRequest() ([]HNSEndpoint, error) {
+	var endpoint []HNSEndpoint
+	err := hnsCall("GET", "/endpoints/", "", &endpoint)
+	if err != nil {
+		return nil, err
+	}
+
+	return endpoint, nil
+}
+
+// GetHNSEndpointByID get the Endpoint by ID
+func GetHNSEndpointByID(endpointID string) (*HNSEndpoint, error) {
+	return HNSEndpointRequest("GET", endpointID, "")
+}
+
+// GetHNSEndpointByName gets the endpoint filtered by Name
+func GetHNSEndpointByName(endpointName string) (*HNSEndpoint, error) {
+	hnsResponse, err := HNSListEndpointRequest()
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsEndpoint := range hnsResponse {
+		if hnsEndpoint.Name == endpointName {
+			return &hnsEndpoint, nil
+		}
+	}
+	return nil, EndpointNotFoundError{EndpointName: endpointName}
+}
+
+// Create Endpoint by sending EndpointRequest to HNS. TODO: Create a separate HNS interface to place all these methods
+func (endpoint *HNSEndpoint) Create() (*HNSEndpoint, error) {
+	operation := "Create"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	return HNSEndpointRequest("POST", "", string(jsonString))
+}
+
+// Delete Endpoint by sending EndpointRequest to HNS
+func (endpoint *HNSEndpoint) Delete() (*HNSEndpoint, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	return HNSEndpointRequest("DELETE", endpoint.Id, "")
+}
+
+// Update Endpoint
+func (endpoint *HNSEndpoint) Update() (*HNSEndpoint, error) {
+	operation := "Update"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	jsonString, err := json.Marshal(endpoint)
+	if err != nil {
+		return nil, err
+	}
+	err = hnsCall("POST", "/endpoints/"+endpoint.Id, string(jsonString), &endpoint)
+
+	return endpoint, err
+}
+
+// ApplyACLPolicy applies a set of ACL Policies on the Endpoint
+func (endpoint *HNSEndpoint) ApplyACLPolicy(policies ...*ACLPolicy) error {
+	operation := "ApplyACLPolicy"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	for _, policy := range policies {
+		if policy == nil {
+			continue
+		}
+		jsonString, err := json.Marshal(policy)
+		if err != nil {
+			return err
+		}
+		endpoint.Policies = append(endpoint.Policies, jsonString)
+	}
+
+	_, err := endpoint.Update()
+	return err
+}
+
+// ContainerAttach attaches an endpoint to container
+func (endpoint *HNSEndpoint) ContainerAttach(containerID string, compartmentID uint16) error {
+	operation := "ContainerAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID:   containerID,
+		CompartmentID: compartmentID,
+		SystemType:    ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// ContainerDetach detaches an endpoint from container
+func (endpoint *HNSEndpoint) ContainerDetach(containerID string) error {
+	operation := "ContainerDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		ContainerID: containerID,
+		SystemType:  ContainerType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// HostAttach attaches a nic on the host
+func (endpoint *HNSEndpoint) HostAttach(compartmentID uint16) error {
+	operation := "HostAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		CompartmentID: compartmentID,
+		SystemType:    HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+
+}
+
+// HostDetach detaches a nic on the host
+func (endpoint *HNSEndpoint) HostDetach() error {
+	operation := "HostDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: HostType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}
+
+// VirtualMachineNICAttach attaches a endpoint to a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICAttach(virtualMachineNICName string) error {
+	operation := "VirtualMachineNicAttach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+	requestMessage := &EndpointAttachDetachRequest{
+		VirtualNICName: virtualMachineNICName,
+		SystemType:     VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/attach", string(jsonString), &response)
+}
+
+// VirtualMachineNICDetach detaches a endpoint  from a virtual machine
+func (endpoint *HNSEndpoint) VirtualMachineNICDetach() error {
+	operation := "VirtualMachineNicDetach"
+	title := "hcsshim::HNSEndpoint::" + operation
+	logrus.Debugf(title+" id=%s", endpoint.Id)
+
+	requestMessage := &EndpointAttachDetachRequest{
+		SystemType: VirtualMachineType,
+	}
+	response := &EndpointResquestResponse{}
+
+	jsonString, err := json.Marshal(requestMessage)
+	if err != nil {
+		return err
+	}
+	return hnsCall("POST", "/endpoints/"+endpoint.Id+"/detach", string(jsonString), &response)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsfuncs.go

@@ -0,0 +1,42 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+
+	"github.com/Microsoft/hcsshim/internal/hcserror"
+	"github.com/Microsoft/hcsshim/internal/interop"
+	"github.com/sirupsen/logrus"
+)
+
+func hnsCall(method, path, request string, returnResponse interface{}) error {
+	var responseBuffer *uint16
+	logrus.Debugf("[%s]=>[%s] Request : %s", method, path, request)
+
+	err := _hnsCall(method, path, request, &responseBuffer)
+	if err != nil {
+		return hcserror.New(err, "hnsCall ", "")
+	}
+	response := interop.ConvertAndFreeCoTaskMemString(responseBuffer)
+
+	hnsresponse := &hnsResponse{}
+	if err = json.Unmarshal([]byte(response), &hnsresponse); err != nil {
+		return err
+	}
+
+	if !hnsresponse.Success {
+		return fmt.Errorf("HNS failed with error : %s", hnsresponse.Error)
+	}
+
+	if len(hnsresponse.Output) == 0 {
+		return nil
+	}
+
+	logrus.Debugf("Network Response : %s", hnsresponse.Output)
+	err = json.Unmarshal(hnsresponse.Output, returnResponse)
+	if err != nil {
+		return err
+	}
+
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsglobals.go

@@ -0,0 +1,28 @@
+package hns
+
+type HNSGlobals struct {
+	Version HNSVersion `json:"Version"`
+}
+
+type HNSVersion struct {
+	Major int `json:"Major"`
+	Minor int `json:"Minor"`
+}
+
+var (
+	HNSVersion1803 = HNSVersion{Major: 7, Minor: 2}
+)
+
+func GetHNSGlobals() (*HNSGlobals, error) {
+	var version HNSVersion
+	err := hnsCall("GET", "/globals/version", "", &version)
+	if err != nil {
+		return nil, err
+	}
+
+	globals := &HNSGlobals{
+		Version: version,
+	}
+
+	return globals, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnsnetwork.go

@@ -0,0 +1,141 @@
+package hns
+
+import (
+	"encoding/json"
+	"net"
+
+	"github.com/sirupsen/logrus"
+)
+
+// Subnet is assoicated with a network and represents a list
+// of subnets available to the network
+type Subnet struct {
+	AddressPrefix  string            `json:",omitempty"`
+	GatewayAddress string            `json:",omitempty"`
+	Policies       []json.RawMessage `json:",omitempty"`
+}
+
+// MacPool is assoicated with a network and represents a list
+// of macaddresses available to the network
+type MacPool struct {
+	StartMacAddress string `json:",omitempty"`
+	EndMacAddress   string `json:",omitempty"`
+}
+
+// HNSNetwork represents a network in HNS
+type HNSNetwork struct {
+	Id                   string            `json:"ID,omitempty"`
+	Name                 string            `json:",omitempty"`
+	Type                 string            `json:",omitempty"`
+	NetworkAdapterName   string            `json:",omitempty"`
+	SourceMac            string            `json:",omitempty"`
+	Policies             []json.RawMessage `json:",omitempty"`
+	MacPools             []MacPool         `json:",omitempty"`
+	Subnets              []Subnet          `json:",omitempty"`
+	DNSSuffix            string            `json:",omitempty"`
+	DNSServerList        string            `json:",omitempty"`
+	DNSServerCompartment uint32            `json:",omitempty"`
+	ManagementIP         string            `json:",omitempty"`
+	AutomaticDNS         bool              `json:",omitempty"`
+}
+
+type hnsNetworkResponse struct {
+	Success bool
+	Error   string
+	Output  HNSNetwork
+}
+
+type hnsResponse struct {
+	Success bool
+	Error   string
+	Output  json.RawMessage
+}
+
+// HNSNetworkRequest makes a call into HNS to update/query a single network
+func HNSNetworkRequest(method, path, request string) (*HNSNetwork, error) {
+	var network HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return &network, nil
+}
+
+// HNSListNetworkRequest makes a HNS call to query the list of available networks
+func HNSListNetworkRequest(method, path, request string) ([]HNSNetwork, error) {
+	var network []HNSNetwork
+	err := hnsCall(method, "/networks/"+path, request, &network)
+	if err != nil {
+		return nil, err
+	}
+
+	return network, nil
+}
+
+// GetHNSNetworkByID
+func GetHNSNetworkByID(networkID string) (*HNSNetwork, error) {
+	return HNSNetworkRequest("GET", networkID, "")
+}
+
+// GetHNSNetworkName filtered by Name
+func GetHNSNetworkByName(networkName string) (*HNSNetwork, error) {
+	hsnnetworks, err := HNSListNetworkRequest("GET", "", "")
+	if err != nil {
+		return nil, err
+	}
+	for _, hnsnetwork := range hsnnetworks {
+		if hnsnetwork.Name == networkName {
+			return &hnsnetwork, nil
+		}
+	}
+	return nil, NetworkNotFoundError{NetworkName: networkName}
+}
+
+// Create Network by sending NetworkRequest to HNS.
+func (network *HNSNetwork) Create() (*HNSNetwork, error) {
+	operation := "Create"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	jsonString, err := json.Marshal(network)
+	if err != nil {
+		return nil, err
+	}
+	return HNSNetworkRequest("POST", "", string(jsonString))
+}
+
+// Delete Network by sending NetworkRequest to HNS
+func (network *HNSNetwork) Delete() (*HNSNetwork, error) {
+	operation := "Delete"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+
+	return HNSNetworkRequest("DELETE", network.Id, "")
+}
+
+// Creates an endpoint on the Network.
+func (network *HNSNetwork) NewEndpoint(ipAddress net.IP, macAddress net.HardwareAddr) *HNSEndpoint {
+	return &HNSEndpoint{
+		VirtualNetwork: network.Id,
+		IPAddress:      ipAddress,
+		MacAddress:     string(macAddress),
+	}
+}
+
+func (network *HNSNetwork) CreateEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s, endpointId=%s", network.Id, endpoint.Id)
+
+	endpoint.VirtualNetwork = network.Id
+	return endpoint.Create()
+}
+
+func (network *HNSNetwork) CreateRemoteEndpoint(endpoint *HNSEndpoint) (*HNSEndpoint, error) {
+	operation := "CreateRemoteEndpoint"
+	title := "hcsshim::HNSNetwork::" + operation
+	logrus.Debugf(title+" id=%s", network.Id)
+	endpoint.IsRemoteEndpoint = true
+	return network.CreateEndpoint(endpoint)
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicy.go

@@ -0,0 +1,98 @@
+package hns
+
+// Type of Request Support in ModifySystem
+type PolicyType string
+
+// RequestType const
+const (
+	Nat                  PolicyType = "NAT"
+	ACL                  PolicyType = "ACL"
+	PA                   PolicyType = "PA"
+	VLAN                 PolicyType = "VLAN"
+	VSID                 PolicyType = "VSID"
+	VNet                 PolicyType = "VNET"
+	L2Driver             PolicyType = "L2Driver"
+	Isolation            PolicyType = "Isolation"
+	QOS                  PolicyType = "QOS"
+	OutboundNat          PolicyType = "OutBoundNAT"
+	ExternalLoadBalancer PolicyType = "ELB"
+	Route                PolicyType = "ROUTE"
+)
+
+type NatPolicy struct {
+	Type         PolicyType `json:"Type"`
+	Protocol     string
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+type QosPolicy struct {
+	Type                            PolicyType `json:"Type"`
+	MaximumOutgoingBandwidthInBytes uint64
+}
+
+type IsolationPolicy struct {
+	Type               PolicyType `json:"Type"`
+	VLAN               uint
+	VSID               uint
+	InDefaultIsolation bool
+}
+
+type VlanPolicy struct {
+	Type PolicyType `json:"Type"`
+	VLAN uint
+}
+
+type VsidPolicy struct {
+	Type PolicyType `json:"Type"`
+	VSID uint
+}
+
+type PaPolicy struct {
+	Type PolicyType `json:"Type"`
+	PA   string     `json:"PA"`
+}
+
+type OutboundNatPolicy struct {
+	Policy
+	VIP        string   `json:"VIP,omitempty"`
+	Exceptions []string `json:"ExceptionList,omitempty"`
+}
+
+type ActionType string
+type DirectionType string
+type RuleType string
+
+const (
+	Allow ActionType = "Allow"
+	Block ActionType = "Block"
+
+	In  DirectionType = "In"
+	Out DirectionType = "Out"
+
+	Host   RuleType = "Host"
+	Switch RuleType = "Switch"
+)
+
+type ACLPolicy struct {
+	Type            PolicyType `json:"Type"`
+	Id              string     `json:"Id,omitempty"`
+	Protocol        uint16
+	Protocols       string `json:"Protocols,omitempty"`
+	InternalPort    uint16
+	Action          ActionType
+	Direction       DirectionType
+	LocalAddresses  string
+	RemoteAddresses string
+	LocalPorts      string `json:"LocalPorts,omitempty"`
+	LocalPort       uint16
+	RemotePorts     string `json:"RemotePorts,omitempty"`
+	RemotePort      uint16
+	RuleType        RuleType `json:"RuleType,omitempty"`
+	Priority        uint16
+	ServiceName     string
+}
+
+type Policy struct {
+	Type PolicyType `json:"Type"`
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnspolicylist.go

@@ -0,0 +1,201 @@
+package hns
+
+import (
+	"encoding/json"
+
+	"github.com/sirupsen/logrus"
+)
+
+// RoutePolicy is a structure defining schema for Route based Policy
+type RoutePolicy struct {
+	Policy
+	DestinationPrefix string `json:"DestinationPrefix,omitempty"`
+	NextHop           string `json:"NextHop,omitempty"`
+	EncapEnabled      bool   `json:"NeedEncap,omitempty"`
+}
+
+// ELBPolicy is a structure defining schema for ELB LoadBalancing based Policy
+type ELBPolicy struct {
+	LBPolicy
+	SourceVIP string   `json:"SourceVIP,omitempty"`
+	VIPs      []string `json:"VIPs,omitempty"`
+	ILB       bool     `json:"ILB,omitempty"`
+	DSR       bool     `json:"IsDSR,omitempty"`
+}
+
+// LBPolicy is a structure defining schema for LoadBalancing based Policy
+type LBPolicy struct {
+	Policy
+	Protocol     uint16 `json:"Protocol,omitempty"`
+	InternalPort uint16
+	ExternalPort uint16
+}
+
+// PolicyList is a structure defining schema for Policy list request
+type PolicyList struct {
+	ID                 string            `json:"ID,omitempty"`
+	EndpointReferences []string          `json:"References,omitempty"`
+	Policies           []json.RawMessage `json:"Policies,omitempty"`
+}
+
+// HNSPolicyListRequest makes a call into HNS to update/query a single network
+func HNSPolicyListRequest(method, path, request string) (*PolicyList, error) {
+	var policy PolicyList
+	err := hnsCall(method, "/policylists/"+path, request, &policy)
+	if err != nil {
+		return nil, err
+	}
+
+	return &policy, nil
+}
+
+// HNSListPolicyListRequest gets all the policy list
+func HNSListPolicyListRequest() ([]PolicyList, error) {
+	var plist []PolicyList
+	err := hnsCall("GET", "/policylists/", "", &plist)
+	if err != nil {
+		return nil, err
+	}
+
+	return plist, nil
+}
+
+// PolicyListRequest makes a HNS call to modify/query a network policy list
+func PolicyListRequest(method, path, request string) (*PolicyList, error) {
+	policylist := &PolicyList{}
+	err := hnsCall(method, "/policylists/"+path, request, &policylist)
+	if err != nil {
+		return nil, err
+	}
+
+	return policylist, nil
+}
+
+// GetPolicyListByID get the policy list by ID
+func GetPolicyListByID(policyListID string) (*PolicyList, error) {
+	return PolicyListRequest("GET", policyListID, "")
+}
+
+// Create PolicyList by sending PolicyListRequest to HNS.
+func (policylist *PolicyList) Create() (*PolicyList, error) {
+	operation := "Create"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+	jsonString, err := json.Marshal(policylist)
+	if err != nil {
+		return nil, err
+	}
+	return PolicyListRequest("POST", "", string(jsonString))
+}
+
+// Delete deletes PolicyList
+func (policylist *PolicyList) Delete() (*PolicyList, error) {
+	operation := "Delete"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s", policylist.ID)
+
+	return PolicyListRequest("DELETE", policylist.ID, "")
+}
+
+// AddEndpoint add an endpoint to a Policy List
+func (policylist *PolicyList) AddEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "AddEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	// Add Endpoint to the Existing List
+	policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+
+	return policylist.Create()
+}
+
+// RemoveEndpoint removes an endpoint from the Policy List
+func (policylist *PolicyList) RemoveEndpoint(endpoint *HNSEndpoint) (*PolicyList, error) {
+	operation := "RemoveEndpoint"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" id=%s, endpointId:%s", policylist.ID, endpoint.Id)
+
+	_, err := policylist.Delete()
+	if err != nil {
+		return nil, err
+	}
+
+	elementToRemove := "/endpoints/" + endpoint.Id
+
+	var references []string
+
+	for _, endpointReference := range policylist.EndpointReferences {
+		if endpointReference == elementToRemove {
+			continue
+		}
+		references = append(references, endpointReference)
+	}
+	policylist.EndpointReferences = references
+	return policylist.Create()
+}
+
+// AddLoadBalancer policy list for the specified endpoints
+func AddLoadBalancer(endpoints []HNSEndpoint, isILB bool, sourceVIP, vip string, protocol uint16, internalPort uint16, externalPort uint16) (*PolicyList, error) {
+	operation := "AddLoadBalancer"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" endpointId=%v, isILB=%v, sourceVIP=%s, vip=%s, protocol=%v, internalPort=%v, externalPort=%v", endpoints, isILB, sourceVIP, vip, protocol, internalPort, externalPort)
+
+	policylist := &PolicyList{}
+
+	elbPolicy := &ELBPolicy{
+		SourceVIP: sourceVIP,
+		ILB:       isILB,
+	}
+
+	if len(vip) > 0 {
+		elbPolicy.VIPs = []string{vip}
+	}
+	elbPolicy.Type = ExternalLoadBalancer
+	elbPolicy.Protocol = protocol
+	elbPolicy.InternalPort = internalPort
+	elbPolicy.ExternalPort = externalPort
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(elbPolicy)
+	if err != nil {
+		return nil, err
+	}
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}
+
+// AddRoute adds route policy list for the specified endpoints
+func AddRoute(endpoints []HNSEndpoint, destinationPrefix string, nextHop string, encapEnabled bool) (*PolicyList, error) {
+	operation := "AddRoute"
+	title := "hcsshim::PolicyList::" + operation
+	logrus.Debugf(title+" destinationPrefix:%s", destinationPrefix)
+
+	policylist := &PolicyList{}
+
+	rPolicy := &RoutePolicy{
+		DestinationPrefix: destinationPrefix,
+		NextHop:           nextHop,
+		EncapEnabled:      encapEnabled,
+	}
+	rPolicy.Type = Route
+
+	for _, endpoint := range endpoints {
+		policylist.EndpointReferences = append(policylist.EndpointReferences, "/endpoints/"+endpoint.Id)
+	}
+
+	jsonString, err := json.Marshal(rPolicy)
+	if err != nil {
+		return nil, err
+	}
+
+	policylist.Policies = append(policylist.Policies, jsonString)
+	return policylist.Create()
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/hnssupport.go

@@ -0,0 +1,49 @@
+package hns
+
+import (
+	"github.com/sirupsen/logrus"
+)
+
+type HNSSupportedFeatures struct {
+	Acl HNSAclFeatures `json:"ACL"`
+}
+
+type HNSAclFeatures struct {
+	AclAddressLists       bool `json:"AclAddressLists"`
+	AclNoHostRulePriority bool `json:"AclHostRulePriority"`
+	AclPortRanges         bool `json:"AclPortRanges"`
+	AclRuleId             bool `json:"AclRuleId"`
+}
+
+func GetHNSSupportedFeatures() HNSSupportedFeatures {
+	var hnsFeatures HNSSupportedFeatures
+
+	globals, err := GetHNSGlobals()
+	if err != nil {
+		// Expected on pre-1803 builds, all features will be false/unsupported
+		logrus.Debugf("Unable to obtain HNS globals: %s", err)
+		return hnsFeatures
+	}
+
+	hnsFeatures.Acl = HNSAclFeatures{
+		AclAddressLists:       isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclNoHostRulePriority: isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclPortRanges:         isHNSFeatureSupported(globals.Version, HNSVersion1803),
+		AclRuleId:             isHNSFeatureSupported(globals.Version, HNSVersion1803),
+	}
+
+	return hnsFeatures
+}
+
+func isHNSFeatureSupported(currentVersion HNSVersion, minVersionSupported HNSVersion) bool {
+	if currentVersion.Major < minVersionSupported.Major {
+		return false
+	}
+	if currentVersion.Major > minVersionSupported.Major {
+		return true
+	}
+	if currentVersion.Minor < minVersionSupported.Minor {
+		return false
+	}
+	return true
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/namespace.go

@@ -0,0 +1,110 @@
+package hns
+
+import (
+	"encoding/json"
+	"fmt"
+	"os"
+	"path"
+	"strings"
+)
+
+type namespaceRequest struct {
+	IsDefault bool `json:",omitempty"`
+}
+
+type namespaceEndpointRequest struct {
+	ID string `json:"Id"`
+}
+
+type NamespaceResource struct {
+	Type string
+	Data json.RawMessage
+}
+
+type namespaceResourceRequest struct {
+	Type string
+	Data interface{}
+}
+
+type Namespace struct {
+	ID           string
+	IsDefault    bool                `json:",omitempty"`
+	ResourceList []NamespaceResource `json:",omitempty"`
+}
+
+func issueNamespaceRequest(id *string, method, subpath string, request interface{}) (*Namespace, error) {
+	var err error
+	hnspath := "/namespaces/"
+	if id != nil {
+		hnspath = path.Join(hnspath, *id)
+	}
+	if subpath != "" {
+		hnspath = path.Join(hnspath, subpath)
+	}
+	var reqJSON []byte
+	if request != nil {
+		if reqJSON, err = json.Marshal(request); err != nil {
+			return nil, err
+		}
+	}
+	var ns Namespace
+	err = hnsCall(method, hnspath, string(reqJSON), &ns)
+	if err != nil {
+		if strings.Contains(err.Error(), "Element not found.") {
+			return nil, os.ErrNotExist
+		}
+		return nil, fmt.Errorf("%s %s: %s", method, hnspath, err)
+	}
+	return &ns, err
+}
+
+func CreateNamespace() (string, error) {
+	req := namespaceRequest{}
+	ns, err := issueNamespaceRequest(nil, "POST", "", &req)
+	if err != nil {
+		return "", err
+	}
+	return ns.ID, nil
+}
+
+func RemoveNamespace(id string) error {
+	_, err := issueNamespaceRequest(&id, "DELETE", "", nil)
+	return err
+}
+
+func GetNamespaceEndpoints(id string) ([]string, error) {
+	ns, err := issueNamespaceRequest(&id, "GET", "", nil)
+	if err != nil {
+		return nil, err
+	}
+	var endpoints []string
+	for _, rsrc := range ns.ResourceList {
+		if rsrc.Type == "Endpoint" {
+			var endpoint namespaceEndpointRequest
+			err = json.Unmarshal(rsrc.Data, &endpoint)
+			if err != nil {
+				return nil, fmt.Errorf("unmarshal endpoint: %s", err)
+			}
+			endpoints = append(endpoints, endpoint.ID)
+		}
+	}
+	return endpoints, nil
+}
+
+func AddNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "addresource", &resource)
+	return err
+}
+
+func RemoveNamespaceEndpoint(id string, endpointID string) error {
+	resource := namespaceResourceRequest{
+		Type: "Endpoint",
+		Data: namespaceEndpointRequest{endpointID},
+	}
+	_, err := issueNamespaceRequest(&id, "POST", "removeresource", &resource)
+	return err
+}

vendor/github.com/Microsoft/hcsshim/internal/hns/zsyscall_windows.go

@@ -0,0 +1,76 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package hns
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modvmcompute = windows.NewLazySystemDLL("vmcompute.dll")
+
+	procHNSCall = modvmcompute.NewProc("HNSCall")
+)
+
+func _hnsCall(method string, path string, object string, response **uint16) (hr error) {
+	var _p0 *uint16
+	_p0, hr = syscall.UTF16PtrFromString(method)
+	if hr != nil {
+		return
+	}
+	var _p1 *uint16
+	_p1, hr = syscall.UTF16PtrFromString(path)
+	if hr != nil {
+		return
+	}
+	var _p2 *uint16
+	_p2, hr = syscall.UTF16PtrFromString(object)
+	if hr != nil {
+		return
+	}
+	return __hnsCall(_p0, _p1, _p2, response)
+}
+
+func __hnsCall(method *uint16, path *uint16, object *uint16, response **uint16) (hr error) {
+	if hr = procHNSCall.Find(); hr != nil {
+		return
+	}
+	r0, _, _ := syscall.Syscall6(procHNSCall.Addr(), 4, uintptr(unsafe.Pointer(method)), uintptr(unsafe.Pointer(path)), uintptr(unsafe.Pointer(object)), uintptr(unsafe.Pointer(response)), 0, 0)
+	if int32(r0) < 0 {
+		if r0&0x1fff0000 == 0x00070000 {
+			r0 &= 0xffff
+		}
+		hr = syscall.Errno(r0)
+	}
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/interop.go

@@ -0,0 +1,27 @@
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+)
+
+//go:generate go run ../../mksyscall_windows.go -output zsyscall_windows.go interop.go
+
+//sys coTaskMemFree(buffer unsafe.Pointer) = api_ms_win_core_com_l1_1_0.CoTaskMemFree
+
+func ConvertAndFreeCoTaskMemString(buffer *uint16) string {
+	str := syscall.UTF16ToString((*[1 << 29]uint16)(unsafe.Pointer(buffer))[:])
+	coTaskMemFree(unsafe.Pointer(buffer))
+	return str
+}
+
+func ConvertAndFreeCoTaskMemBytes(buffer *uint16) []byte {
+	return []byte(ConvertAndFreeCoTaskMemString(buffer))
+}
+
+func Win32FromHresult(hr uintptr) syscall.Errno {
+	if hr&0x1fff0000 == 0x00070000 {
+		return syscall.Errno(hr & 0xffff)
+	}
+	return syscall.Errno(hr)
+}

vendor/github.com/Microsoft/hcsshim/internal/interop/zsyscall_windows.go

@@ -0,0 +1,48 @@
+// Code generated mksyscall_windows.exe DO NOT EDIT
+
+package interop
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modapi_ms_win_core_com_l1_1_0 = windows.NewLazySystemDLL("api-ms-win-core-com-l1-1-0.dll")
+
+	procCoTaskMemFree = modapi_ms_win_core_com_l1_1_0.NewProc("CoTaskMemFree")
+)
+
+func coTaskMemFree(buffer unsafe.Pointer) {
+	syscall.Syscall(procCoTaskMemFree.Addr(), 1, uintptr(buffer), 0, 0)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/logfields/fields.go

@@ -0,0 +1,32 @@
+package logfields
+
+const (
+	// Identifiers
+
+	ContainerID = "cid"
+	UVMID       = "uvm-id"
+	ProcessID   = "pid"
+
+	// Common Misc
+
+	// Timeout represents an operation timeout.
+	Timeout = "timeout"
+	JSON    = "json"
+
+	// Keys/values
+
+	Field         = "field"
+	OCIAnnotation = "oci-annotation"
+	Value         = "value"
+
+	// Golang type's
+
+	ExpectedType = "expected-type"
+	Bool         = "bool"
+	Uint32       = "uint32"
+	Uint64       = "uint64"
+
+	// runhcs
+
+	VMShimOperation = "vmshim-op"
+)

vendor/github.com/Microsoft/hcsshim/internal/longpath/longpath.go

@@ -0,0 +1,24 @@
+package longpath
+
+import (
+	"path/filepath"
+	"strings"
+)
+
+// LongAbs makes a path absolute and returns it in NT long path form.
+func LongAbs(path string) (string, error) {
+	if strings.HasPrefix(path, `\\?\`) || strings.HasPrefix(path, `\\.\`) {
+		return path, nil
+	}
+	if !filepath.IsAbs(path) {
+		absPath, err := filepath.Abs(path)
+		if err != nil {
+			return "", err
+		}
+		path = absPath
+	}
+	if strings.HasPrefix(path, `\\`) {
+		return `\\?\UNC\` + path[2:], nil
+	}
+	return `\\?\` + path, nil
+}

vendor/github.com/Microsoft/hcsshim/internal/mergemaps/merge.go

@@ -0,0 +1,52 @@
+package mergemaps
+
+import "encoding/json"
+
+// Merge recursively merges map `fromMap` into map `ToMap`. Any pre-existing values
+// in ToMap are overwritten. Values in fromMap are added to ToMap.
+// From http://stackoverflow.com/questions/40491438/merging-two-json-strings-in-golang
+func Merge(fromMap, ToMap interface{}) interface{} {
+	switch fromMap := fromMap.(type) {
+	case map[string]interface{}:
+		ToMap, ok := ToMap.(map[string]interface{})
+		if !ok {
+			return fromMap
+		}
+		for keyToMap, valueToMap := range ToMap {
+			if valueFromMap, ok := fromMap[keyToMap]; ok {
+				fromMap[keyToMap] = Merge(valueFromMap, valueToMap)
+			} else {
+				fromMap[keyToMap] = valueToMap
+			}
+		}
+	case nil:
+		// merge(nil, map[string]interface{...}) -> map[string]interface{...}
+		ToMap, ok := ToMap.(map[string]interface{})
+		if ok {
+			return ToMap
+		}
+	}
+	return fromMap
+}
+
+// MergeJSON merges the contents of a JSON string into an object representation,
+// returning a new object suitable for translating to JSON.
+func MergeJSON(object interface{}, additionalJSON []byte) (interface{}, error) {
+	if len(additionalJSON) == 0 {
+		return object, nil
+	}
+	objectJSON, err := json.Marshal(object)
+	if err != nil {
+		return nil, err
+	}
+	var objectMap, newMap map[string]interface{}
+	err = json.Unmarshal(objectJSON, &objectMap)
+	if err != nil {
+		return nil, err
+	}
+	err = json.Unmarshal(additionalJSON, &newMap)
+	if err != nil {
+		return nil, err
+	}
+	return Merge(newMap, objectMap), nil
+}

vendor/github.com/Microsoft/hcsshim/internal/safefile/safeopen.go

@@ -0,0 +1,431 @@
+package safefile
+
+import (
+	"errors"
+	"io"
+	"os"
+	"path/filepath"
+	"strings"
+	"syscall"
+	"unicode/utf16"
+	"unsafe"
+
+	"github.com/Microsoft/hcsshim/internal/longpath"
+
+	winio "github.com/Microsoft/go-winio"
+)
+
+//go:generate go run $GOROOT\src\syscall\mksyscall_windows.go -output zsyscall_windows.go safeopen.go
+
+//sys ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) = ntdll.NtCreateFile
+//sys ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) = ntdll.NtSetInformationFile
+//sys rtlNtStatusToDosError(status uint32) (winerr error) = ntdll.RtlNtStatusToDosErrorNoTeb
+//sys localAlloc(flags uint32, size int) (ptr uintptr) = kernel32.LocalAlloc
+//sys localFree(ptr uintptr) = kernel32.LocalFree
+
+type ioStatusBlock struct {
+	Status, Information uintptr
+}
+
+type objectAttributes struct {
+	Length             uintptr
+	RootDirectory      uintptr
+	ObjectName         uintptr
+	Attributes         uintptr
+	SecurityDescriptor uintptr
+	SecurityQoS        uintptr
+}
+
+type unicodeString struct {
+	Length        uint16
+	MaximumLength uint16
+	Buffer        uintptr
+}
+
+type fileLinkInformation struct {
+	ReplaceIfExists bool
+	RootDirectory   uintptr
+	FileNameLength  uint32
+	FileName        [1]uint16
+}
+
+type fileDispositionInformationEx struct {
+	Flags uintptr
+}
+
+const (
+	_FileLinkInformation          = 11
+	_FileDispositionInformationEx = 64
+
+	FILE_READ_ATTRIBUTES  = 0x0080
+	FILE_WRITE_ATTRIBUTES = 0x0100
+	DELETE                = 0x10000
+
+	FILE_OPEN   = 1
+	FILE_CREATE = 2
+
+	FILE_DIRECTORY_FILE          = 0x00000001
+	FILE_SYNCHRONOUS_IO_NONALERT = 0x00000020
+	FILE_DELETE_ON_CLOSE         = 0x00001000
+	FILE_OPEN_FOR_BACKUP_INTENT  = 0x00004000
+	FILE_OPEN_REPARSE_POINT      = 0x00200000
+
+	FILE_DISPOSITION_DELETE = 0x00000001
+
+	_OBJ_DONT_REPARSE = 0x1000
+
+	_STATUS_REPARSE_POINT_ENCOUNTERED = 0xC000050B
+)
+
+func OpenRoot(path string) (*os.File, error) {
+	longpath, err := longpath.LongAbs(path)
+	if err != nil {
+		return nil, err
+	}
+	return winio.OpenForBackup(longpath, syscall.GENERIC_READ, syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE, syscall.OPEN_EXISTING)
+}
+
+func ntRelativePath(path string) ([]uint16, error) {
+	path = filepath.Clean(path)
+	if strings.Contains(path, ":") {
+		// Since alternate data streams must follow the file they
+		// are attached to, finding one here (out of order) is invalid.
+		return nil, errors.New("path contains invalid character `:`")
+	}
+	fspath := filepath.FromSlash(path)
+	if len(fspath) > 0 && fspath[0] == '\\' {
+		return nil, errors.New("expected relative path")
+	}
+
+	path16 := utf16.Encode(([]rune)(fspath))
+	if len(path16) > 32767 {
+		return nil, syscall.ENAMETOOLONG
+	}
+
+	return path16, nil
+}
+
+// openRelativeInternal opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func openRelativeInternal(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	var (
+		h    uintptr
+		iosb ioStatusBlock
+		oa   objectAttributes
+	)
+
+	path16, err := ntRelativePath(path)
+	if err != nil {
+		return nil, err
+	}
+
+	if root == nil || root.Fd() == 0 {
+		return nil, errors.New("missing root directory")
+	}
+
+	upathBuffer := localAlloc(0, int(unsafe.Sizeof(unicodeString{}))+len(path16)*2)
+	defer localFree(upathBuffer)
+
+	upath := (*unicodeString)(unsafe.Pointer(upathBuffer))
+	upath.Length = uint16(len(path16) * 2)
+	upath.MaximumLength = upath.Length
+	upath.Buffer = upathBuffer + unsafe.Sizeof(*upath)
+	copy((*[32768]uint16)(unsafe.Pointer(upath.Buffer))[:], path16)
+
+	oa.Length = unsafe.Sizeof(oa)
+	oa.ObjectName = upathBuffer
+	oa.RootDirectory = uintptr(root.Fd())
+	oa.Attributes = _OBJ_DONT_REPARSE
+	status := ntCreateFile(
+		&h,
+		accessMask|syscall.SYNCHRONIZE,
+		&oa,
+		&iosb,
+		nil,
+		0,
+		shareFlags,
+		createDisposition,
+		FILE_OPEN_FOR_BACKUP_INTENT|FILE_SYNCHRONOUS_IO_NONALERT|flags,
+		nil,
+		0,
+	)
+	if status != 0 {
+		return nil, rtlNtStatusToDosError(status)
+	}
+
+	fullPath, err := longpath.LongAbs(filepath.Join(root.Name(), path))
+	if err != nil {
+		syscall.Close(syscall.Handle(h))
+		return nil, err
+	}
+
+	return os.NewFile(h, fullPath), nil
+}
+
+// OpenRelative opens a relative path from the given root, failing if
+// any of the intermediate path components are reparse points.
+func OpenRelative(path string, root *os.File, accessMask uint32, shareFlags uint32, createDisposition uint32, flags uint32) (*os.File, error) {
+	f, err := openRelativeInternal(path, root, accessMask, shareFlags, createDisposition, flags)
+	if err != nil {
+		err = &os.PathError{Op: "open", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return f, err
+}
+
+// LinkRelative creates a hard link from oldname to newname (relative to oldroot
+// and newroot), failing if any of the intermediate path components are reparse
+// points.
+func LinkRelative(oldname string, oldroot *os.File, newname string, newroot *os.File) error {
+	// Open the old file.
+	oldf, err := openRelativeInternal(
+		oldname,
+		oldroot,
+		syscall.FILE_WRITE_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0,
+	)
+	if err != nil {
+		return &os.LinkError{Op: "link", Old: filepath.Join(oldroot.Name(), oldname), New: filepath.Join(newroot.Name(), newname), Err: err}
+	}
+	defer oldf.Close()
+
+	// Open the parent of the new file.
+	var parent *os.File
+	parentPath := filepath.Dir(newname)
+	if parentPath != "." {
+		parent, err = openRelativeInternal(
+			parentPath,
+			newroot,
+			syscall.GENERIC_READ,
+			syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+			FILE_OPEN,
+			FILE_DIRECTORY_FILE)
+		if err != nil {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: err}
+		}
+		defer parent.Close()
+
+		fi, err := winio.GetFileBasicInfo(parent)
+		if err != nil {
+			return err
+		}
+		if (fi.FileAttributes & syscall.FILE_ATTRIBUTE_REPARSE_POINT) != 0 {
+			return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(newroot.Name(), newname), Err: rtlNtStatusToDosError(_STATUS_REPARSE_POINT_ENCOUNTERED)}
+		}
+
+	} else {
+		parent = newroot
+	}
+
+	// Issue an NT call to create the link. This will be safe because NT will
+	// not open any more directories to create the link, so it cannot walk any
+	// more reparse points.
+	newbase := filepath.Base(newname)
+	newbase16, err := ntRelativePath(newbase)
+	if err != nil {
+		return err
+	}
+
+	size := int(unsafe.Offsetof(fileLinkInformation{}.FileName)) + len(newbase16)*2
+	linkinfoBuffer := localAlloc(0, size)
+	defer localFree(linkinfoBuffer)
+	linkinfo := (*fileLinkInformation)(unsafe.Pointer(linkinfoBuffer))
+	linkinfo.RootDirectory = parent.Fd()
+	linkinfo.FileNameLength = uint32(len(newbase16) * 2)
+	copy((*[32768]uint16)(unsafe.Pointer(&linkinfo.FileName[0]))[:], newbase16)
+
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		oldf.Fd(),
+		&iosb,
+		linkinfoBuffer,
+		uint32(size),
+		_FileLinkInformation,
+	)
+	if status != 0 {
+		return &os.LinkError{Op: "link", Old: oldf.Name(), New: filepath.Join(parent.Name(), newbase), Err: rtlNtStatusToDosError(status)}
+	}
+
+	return nil
+}
+
+// deleteOnClose marks a file to be deleted when the handle is closed.
+func deleteOnClose(f *os.File) error {
+	disposition := fileDispositionInformationEx{Flags: FILE_DISPOSITION_DELETE}
+	var iosb ioStatusBlock
+	status := ntSetInformationFile(
+		f.Fd(),
+		&iosb,
+		uintptr(unsafe.Pointer(&disposition)),
+		uint32(unsafe.Sizeof(disposition)),
+		_FileDispositionInformationEx,
+	)
+	if status != 0 {
+		return rtlNtStatusToDosError(status)
+	}
+	return nil
+}
+
+// clearReadOnly clears the readonly attribute on a file.
+func clearReadOnly(f *os.File) error {
+	bi, err := winio.GetFileBasicInfo(f)
+	if err != nil {
+		return err
+	}
+	if bi.FileAttributes&syscall.FILE_ATTRIBUTE_READONLY == 0 {
+		return nil
+	}
+	sbi := winio.FileBasicInfo{
+		FileAttributes: bi.FileAttributes &^ syscall.FILE_ATTRIBUTE_READONLY,
+	}
+	if sbi.FileAttributes == 0 {
+		sbi.FileAttributes = syscall.FILE_ATTRIBUTE_NORMAL
+	}
+	return winio.SetFileBasicInfo(f, &sbi)
+}
+
+// RemoveRelative removes a file or directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES|FILE_WRITE_ATTRIBUTES|DELETE,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err == nil {
+		defer f.Close()
+		err = deleteOnClose(f)
+		if err == syscall.ERROR_ACCESS_DENIED {
+			// Maybe the file is marked readonly. Clear the bit and retry.
+			clearReadOnly(f)
+			err = deleteOnClose(f)
+		}
+	}
+	if err != nil {
+		return &os.PathError{Op: "remove", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return nil
+}
+
+// RemoveAllRelative removes a directory tree relative to a root, failing if any
+// intermediate path components are reparse points.
+func RemoveAllRelative(path string, root *os.File) error {
+	fi, err := LstatRelative(path, root)
+	if err != nil {
+		if os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+	fileAttributes := fi.Sys().(*syscall.Win32FileAttributeData).FileAttributes
+	if fileAttributes&syscall.FILE_ATTRIBUTE_DIRECTORY == 0 || fileAttributes&syscall.FILE_ATTRIBUTE_REPARSE_POINT != 0 {
+		// If this is a reparse point, it can't have children. Simple remove will do.
+		err := RemoveRelative(path, root)
+		if err == nil || os.IsNotExist(err) {
+			return nil
+		}
+		return err
+	}
+
+	// It is necessary to use os.Open as Readdirnames does not work with
+	// OpenRelative. This is safe because the above lstatrelative fails
+	// if the target is outside the root, and we know this is not a
+	// symlink from the above FILE_ATTRIBUTE_REPARSE_POINT check.
+	fd, err := os.Open(filepath.Join(root.Name(), path))
+	if err != nil {
+		if os.IsNotExist(err) {
+			// Race. It was deleted between the Lstat and Open.
+			// Return nil per RemoveAll's docs.
+			return nil
+		}
+		return err
+	}
+
+	// Remove contents & return first error.
+	for {
+		names, err1 := fd.Readdirnames(100)
+		for _, name := range names {
+			err1 := RemoveAllRelative(path+string(os.PathSeparator)+name, root)
+			if err == nil {
+				err = err1
+			}
+		}
+		if err1 == io.EOF {
+			break
+		}
+		// If Readdirnames returned an error, use it.
+		if err == nil {
+			err = err1
+		}
+		if len(names) == 0 {
+			break
+		}
+	}
+	fd.Close()
+
+	// Remove directory.
+	err1 := RemoveRelative(path, root)
+	if err1 == nil || os.IsNotExist(err1) {
+		return nil
+	}
+	if err == nil {
+		err = err1
+	}
+	return err
+}
+
+// MkdirRelative creates a directory relative to a root, failing if any
+// intermediate path components are reparse points.
+func MkdirRelative(path string, root *os.File) error {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_CREATE,
+		FILE_DIRECTORY_FILE)
+	if err == nil {
+		f.Close()
+	} else {
+		err = &os.PathError{Op: "mkdir", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	return err
+}
+
+// LstatRelative performs a stat operation on a file relative to a root, failing
+// if any intermediate path components are reparse points.
+func LstatRelative(path string, root *os.File) (os.FileInfo, error) {
+	f, err := openRelativeInternal(
+		path,
+		root,
+		FILE_READ_ATTRIBUTES,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		FILE_OPEN_REPARSE_POINT)
+	if err != nil {
+		return nil, &os.PathError{Op: "stat", Path: filepath.Join(root.Name(), path), Err: err}
+	}
+	defer f.Close()
+	return f.Stat()
+}
+
+// EnsureNotReparsePointRelative validates that a given file (relative to a
+// root) and all intermediate path components are not a reparse points.
+func EnsureNotReparsePointRelative(path string, root *os.File) error {
+	// Perform an open with OBJ_DONT_REPARSE but without specifying FILE_OPEN_REPARSE_POINT.
+	f, err := OpenRelative(
+		path,
+		root,
+		0,
+		syscall.FILE_SHARE_READ|syscall.FILE_SHARE_WRITE|syscall.FILE_SHARE_DELETE,
+		FILE_OPEN,
+		0)
+	if err != nil {
+		return err
+	}
+	f.Close()
+	return nil
+}

vendor/github.com/Microsoft/hcsshim/internal/safefile/zsyscall_windows.go

@@ -0,0 +1,79 @@
+// Code generated by 'go generate'; DO NOT EDIT.
+
+package safefile
+
+import (
+	"syscall"
+	"unsafe"
+
+	"golang.org/x/sys/windows"
+)
+
+var _ unsafe.Pointer
+
+// Do the interface allocations only once for common
+// Errno values.
+const (
+	errnoERROR_IO_PENDING = 997
+)
+
+var (
+	errERROR_IO_PENDING error = syscall.Errno(errnoERROR_IO_PENDING)
+)
+
+// errnoErr returns common boxed Errno values, to prevent
+// allocations at runtime.
+func errnoErr(e syscall.Errno) error {
+	switch e {
+	case 0:
+		return nil
+	case errnoERROR_IO_PENDING:
+		return errERROR_IO_PENDING
+	}
+	// TODO: add more here, after collecting data on the common
+	// error values see on Windows. (perhaps when running
+	// all.bat?)
+	return e
+}
+
+var (
+	modntdll    = windows.NewLazySystemDLL("ntdll.dll")
+	modkernel32 = windows.NewLazySystemDLL("kernel32.dll")
+
+	procNtCreateFile               = modntdll.NewProc("NtCreateFile")
+	procNtSetInformationFile       = modntdll.NewProc("NtSetInformationFile")
+	procRtlNtStatusToDosErrorNoTeb = modntdll.NewProc("RtlNtStatusToDosErrorNoTeb")
+	procLocalAlloc                 = modkernel32.NewProc("LocalAlloc")
+	procLocalFree                  = modkernel32.NewProc("LocalFree")
+)
+
+func ntCreateFile(handle *uintptr, accessMask uint32, oa *objectAttributes, iosb *ioStatusBlock, allocationSize *uint64, fileAttributes uint32, shareAccess uint32, createDisposition uint32, createOptions uint32, eaBuffer *byte, eaLength uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall12(procNtCreateFile.Addr(), 11, uintptr(unsafe.Pointer(handle)), uintptr(accessMask), uintptr(unsafe.Pointer(oa)), uintptr(unsafe.Pointer(iosb)), uintptr(unsafe.Pointer(allocationSize)), uintptr(fileAttributes), uintptr(shareAccess), uintptr(createDisposition), uintptr(createOptions), uintptr(unsafe.Pointer(eaBuffer)), uintptr(eaLength), 0)
+	status = uint32(r0)
+	return
+}
+
+func ntSetInformationFile(handle uintptr, iosb *ioStatusBlock, information uintptr, length uint32, class uint32) (status uint32) {
+	r0, _, _ := syscall.Syscall6(procNtSetInformationFile.Addr(), 5, uintptr(handle), uintptr(unsafe.Pointer(iosb)), uintptr(information), uintptr(length), uintptr(class), 0)
+	status = uint32(r0)
+	return
+}
+
+func rtlNtStatusToDosError(status uint32) (winerr error) {
+	r0, _, _ := syscall.Syscall(procRtlNtStatusToDosErrorNoTeb.Addr(), 1, uintptr(status), 0, 0)
+	if r0 != 0 {
+		winerr = syscall.Errno(r0)
+	}
+	return
+}
+
+func localAlloc(flags uint32, size int) (ptr uintptr) {
+	r0, _, _ := syscall.Syscall(procLocalAlloc.Addr(), 2, uintptr(flags), uintptr(size), 0)
+	ptr = uintptr(r0)
+	return
+}
+
+func localFree(ptr uintptr) {
+	syscall.Syscall(procLocalFree.Addr(), 1, uintptr(ptr), 0, 0)
+	return
+}

vendor/github.com/Microsoft/hcsshim/internal/schema1/schema1.go

@@ -0,0 +1,245 @@
+package schema1
+
+import (
+	"encoding/json"
+	"time"
+
+	"github.com/Microsoft/hcsshim/internal/schema2"
+)
+
+// ProcessConfig is used as both the input of Container.CreateProcess
+// and to convert the parameters to JSON for passing onto the HCS
+type ProcessConfig struct {
+	ApplicationName   string            `json:",omitempty"`
+	CommandLine       string            `json:",omitempty"`
+	CommandArgs       []string          `json:",omitempty"` // Used by Linux Containers on Windows
+	User              string            `json:",omitempty"`
+	WorkingDirectory  string            `json:",omitempty"`
+	Environment       map[string]string `json:",omitempty"`
+	EmulateConsole    bool              `json:",omitempty"`
+	CreateStdInPipe   bool              `json:",omitempty"`
+	CreateStdOutPipe  bool              `json:",omitempty"`
+	CreateStdErrPipe  bool              `json:",omitempty"`
+	ConsoleSize       [2]uint           `json:",omitempty"`
+	CreateInUtilityVm bool              `json:",omitempty"` // Used by Linux Containers on Windows
+	OCISpecification  *json.RawMessage  `json:",omitempty"` // Used by Linux Containers on Windows
+}
+
+type Layer struct {
+	ID   string
+	Path string
+}
+
+type MappedDir struct {
+	HostPath          string
+	ContainerPath     string
+	ReadOnly          bool
+	BandwidthMaximum  uint64
+	IOPSMaximum       uint64
+	CreateInUtilityVM bool
+	// LinuxMetadata - Support added in 1803/RS4+.
+	LinuxMetadata bool `json:",omitempty"`
+}
+
+type MappedPipe struct {
+	HostPath          string
+	ContainerPipeName string
+}
+
+type HvRuntime struct {
+	ImagePath           string `json:",omitempty"`
+	SkipTemplate        bool   `json:",omitempty"`
+	LinuxInitrdFile     string `json:",omitempty"` // File under ImagePath on host containing an initrd image for starting a Linux utility VM
+	LinuxKernelFile     string `json:",omitempty"` // File under ImagePath on host containing a kernel for starting a Linux utility VM
+	LinuxBootParameters string `json:",omitempty"` // Additional boot parameters for starting a Linux Utility VM in initrd mode
+	BootSource          string `json:",omitempty"` // "Vhd" for Linux Utility VM booting from VHD
+	WritableBootSource  bool   `json:",omitempty"` // Linux Utility VM booting from VHD
+}
+
+type MappedVirtualDisk struct {
+	HostPath          string `json:",omitempty"` // Path to VHD on the host
+	ContainerPath     string // Platform-specific mount point path in the container
+	CreateInUtilityVM bool   `json:",omitempty"`
+	ReadOnly          bool   `json:",omitempty"`
+	Cache             string `json:",omitempty"` // "" (Unspecified); "Disabled"; "Enabled"; "Private"; "PrivateAllowSharing"
+	AttachOnly        bool   `json:",omitempty:`
+}
+
+// AssignedDevice represents a device that has been directly assigned to a container
+//
+// NOTE: Support added in RS5
+type AssignedDevice struct {
+	//  InterfaceClassGUID of the device to assign to container.
+	InterfaceClassGUID string `json:"InterfaceClassGuid,omitempty"`
+}
+
+// ContainerConfig is used as both the input of CreateContainer
+// and to convert the parameters to JSON for passing onto the HCS
+type ContainerConfig struct {
+	SystemType                  string              // HCS requires this to be hard-coded to "Container"
+	Name                        string              // Name of the container. We use the docker ID.
+	Owner                       string              `json:",omitempty"` // The management platform that created this container
+	VolumePath                  string              `json:",omitempty"` // Windows volume path for scratch space. Used by Windows Server Containers only. Format \\?\\Volume{GUID}
+	IgnoreFlushesDuringBoot     bool                `json:",omitempty"` // Optimization hint for container startup in Windows
+	LayerFolderPath             string              `json:",omitempty"` // Where the layer folders are located. Used by Windows Server Containers only. Format  %root%\windowsfilter\containerID
+	Layers                      []Layer             // List of storage layers. Required for Windows Server and Hyper-V Containers. Format ID=GUID;Path=%root%\windowsfilter\layerID
+	Credentials                 string              `json:",omitempty"` // Credentials information
+	ProcessorCount              uint32              `json:",omitempty"` // Number of processors to assign to the container.
+	ProcessorWeight             uint64              `json:",omitempty"` // CPU shares (relative weight to other containers with cpu shares). Range is from 1 to 10000. A value of 0 results in default shares.
+	ProcessorMaximum            int64               `json:",omitempty"` // Specifies the portion of processor cycles that this container can use as a percentage times 100. Range is from 1 to 10000. A value of 0 results in no limit.
+	StorageIOPSMaximum          uint64              `json:",omitempty"` // Maximum Storage IOPS
+	StorageBandwidthMaximum     uint64              `json:",omitempty"` // Maximum Storage Bandwidth in bytes per second
+	StorageSandboxSize          uint64              `json:",omitempty"` // Size in bytes that the container system drive should be expanded to if smaller
+	MemoryMaximumInMB           int64               `json:",omitempty"` // Maximum memory available to the container in Megabytes
+	HostName                    string              `json:",omitempty"` // Hostname
+	MappedDirectories           []MappedDir         `json:",omitempty"` // List of mapped directories (volumes/mounts)
+	MappedPipes                 []MappedPipe        `json:",omitempty"` // List of mapped Windows named pipes
+	HvPartition                 bool                // True if it a Hyper-V Container
+	NetworkSharedContainerName  string              `json:",omitempty"` // Name (ID) of the container that we will share the network stack with.
+	EndpointList                []string            `json:",omitempty"` // List of networking endpoints to be attached to container
+	HvRuntime                   *HvRuntime          `json:",omitempty"` // Hyper-V container settings. Used by Hyper-V containers only. Format ImagePath=%root%\BaseLayerID\UtilityVM
+	Servicing                   bool                `json:",omitempty"` // True if this container is for servicing
+	AllowUnqualifiedDNSQuery    bool                `json:",omitempty"` // True to allow unqualified DNS name resolution
+	DNSSearchList               string              `json:",omitempty"` // Comma seperated list of DNS suffixes to use for name resolution
+	ContainerType               string              `json:",omitempty"` // "Linux" for Linux containers on Windows. Omitted otherwise.
+	TerminateOnLastHandleClosed bool                `json:",omitempty"` // Should HCS terminate the container once all handles have been closed
+	MappedVirtualDisks          []MappedVirtualDisk `json:",omitempty"` // Array of virtual disks to mount at start
+	AssignedDevices             []AssignedDevice    `json:",omitempty"` // Array of devices to assign. NOTE: Support added in RS5
+}
+
+type ComputeSystemQuery struct {
+	IDs    []string `json:"Ids,omitempty"`
+	Types  []string `json:",omitempty"`
+	Names  []string `json:",omitempty"`
+	Owners []string `json:",omitempty"`
+}
+
+type PropertyType string
+
+const (
+	PropertyTypeStatistics        PropertyType = "Statistics"        // V1 and V2
+	PropertyTypeProcessList                    = "ProcessList"       // V1 and V2
+	PropertyTypeMappedVirtualDisk              = "MappedVirtualDisk" // Not supported in V2 schema call
+	PropertyTypeGuestConnection                = "GuestConnection"   // V1 and V2. Nil return from HCS before RS5
+)
+
+type PropertyQuery struct {
+	PropertyTypes []PropertyType `json:",omitempty"`
+}
+
+// ContainerProperties holds the properties for a container and the processes running in that container
+type ContainerProperties struct {
+	ID                           string `json:"Id"`
+	State                        string
+	Name                         string
+	SystemType                   string
+	Owner                        string
+	SiloGUID                     string                              `json:"SiloGuid,omitempty"`
+	RuntimeID                    string                              `json:"RuntimeId,omitempty"`
+	IsRuntimeTemplate            bool                                `json:",omitempty"`
+	RuntimeImagePath             string                              `json:",omitempty"`
+	Stopped                      bool                                `json:",omitempty"`
+	ExitType                     string                              `json:",omitempty"`
+	AreUpdatesPending            bool                                `json:",omitempty"`
+	ObRoot                       string                              `json:",omitempty"`
+	Statistics                   Statistics                          `json:",omitempty"`
+	ProcessList                  []ProcessListItem                   `json:",omitempty"`
+	MappedVirtualDiskControllers map[int]MappedVirtualDiskController `json:",omitempty"`
+	GuestConnectionInfo          GuestConnectionInfo                 `json:",omitempty"`
+}
+
+// MemoryStats holds the memory statistics for a container
+type MemoryStats struct {
+	UsageCommitBytes            uint64 `json:"MemoryUsageCommitBytes,omitempty"`
+	UsageCommitPeakBytes        uint64 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+	UsagePrivateWorkingSetBytes uint64 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}
+
+// ProcessorStats holds the processor statistics for a container
+type ProcessorStats struct {
+	TotalRuntime100ns  uint64 `json:",omitempty"`
+	RuntimeUser100ns   uint64 `json:",omitempty"`
+	RuntimeKernel100ns uint64 `json:",omitempty"`
+}
+
+// StorageStats holds the storage statistics for a container
+type StorageStats struct {
+	ReadCountNormalized  uint64 `json:",omitempty"`
+	ReadSizeBytes        uint64 `json:",omitempty"`
+	WriteCountNormalized uint64 `json:",omitempty"`
+	WriteSizeBytes       uint64 `json:",omitempty"`
+}
+
+// NetworkStats holds the network statistics for a container
+type NetworkStats struct {
+	BytesReceived          uint64 `json:",omitempty"`
+	BytesSent              uint64 `json:",omitempty"`
+	PacketsReceived        uint64 `json:",omitempty"`
+	PacketsSent            uint64 `json:",omitempty"`
+	DroppedPacketsIncoming uint64 `json:",omitempty"`
+	DroppedPacketsOutgoing uint64 `json:",omitempty"`
+	EndpointId             string `json:",omitempty"`
+	InstanceId             string `json:",omitempty"`
+}
+
+// Statistics is the structure returned by a statistics call on a container
+type Statistics struct {
+	Timestamp          time.Time      `json:",omitempty"`
+	ContainerStartTime time.Time      `json:",omitempty"`
+	Uptime100ns        uint64         `json:",omitempty"`
+	Memory             MemoryStats    `json:",omitempty"`
+	Processor          ProcessorStats `json:",omitempty"`
+	Storage            StorageStats   `json:",omitempty"`
+	Network            []NetworkStats `json:",omitempty"`
+}
+
+// ProcessList is the structure of an item returned by a ProcessList call on a container
+type ProcessListItem struct {
+	CreateTimestamp              time.Time `json:",omitempty"`
+	ImageName                    string    `json:",omitempty"`
+	KernelTime100ns              uint64    `json:",omitempty"`
+	MemoryCommitBytes            uint64    `json:",omitempty"`
+	MemoryWorkingSetPrivateBytes uint64    `json:",omitempty"`
+	MemoryWorkingSetSharedBytes  uint64    `json:",omitempty"`
+	ProcessId                    uint32    `json:",omitempty"`
+	UserTime100ns                uint64    `json:",omitempty"`
+}
+
+// MappedVirtualDiskController is the structure of an item returned by a MappedVirtualDiskList call on a container
+type MappedVirtualDiskController struct {
+	MappedVirtualDisks map[int]MappedVirtualDisk `json:",omitempty"`
+}
+
+// GuestDefinedCapabilities is part of the GuestConnectionInfo returned by a GuestConnection call on a utility VM
+type GuestDefinedCapabilities struct {
+	NamespaceAddRequestSupported bool `json:",omitempty"`
+	SignalProcessSupported       bool `json:",omitempty"`
+}
+
+// GuestConnectionInfo is the structure of an iterm return by a GuestConnection call on a utility VM
+type GuestConnectionInfo struct {
+	SupportedSchemaVersions  []hcsschema.Version      `json:",omitempty"`
+	ProtocolVersion          uint32                   `json:",omitempty"`
+	GuestDefinedCapabilities GuestDefinedCapabilities `json:",omitempty"`
+}
+
+// Type of Request Support in ModifySystem
+type RequestType string
+
+// Type of Resource Support in ModifySystem
+type ResourceType string
+
+// RequestType const
+const (
+	Add     RequestType  = "Add"
+	Remove  RequestType  = "Remove"
+	Network ResourceType = "Network"
+)
+
+// ResourceModificationRequestResponse is the structure used to send request to the container to modify the system
+// Supported resource types are Network and Request Types are Add/Remove
+type ResourceModificationRequestResponse struct {
+	Resource ResourceType `json:"ResourceType"`
+	Data     interface{}  `json:"Settings"`
+	Request  RequestType  `json:"RequestType,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/attachment.go

@@ -0,0 +1,31 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Attachment struct {
+
+	Type_ string `json:"Type,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	IgnoreFlushes bool `json:"IgnoreFlushes,omitempty"`
+
+	CachingMode string `json:"CachingMode,omitempty"`
+
+	NoWriteHardening bool `json:"NoWriteHardening,omitempty"`
+
+	DisableExpansionOptimization bool `json:"DisableExpansionOptimization,omitempty"`
+
+	IgnoreRelativeLocator bool `json:"IgnoreRelativeLocator,omitempty"`
+
+	CaptureIoAttributionContext bool `json:"CaptureIoAttributionContext,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/battery.go

@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Battery struct {
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/cache_query_stats_response.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CacheQueryStatsResponse struct {
+
+	L3OccupancyBytes int32 `json:"L3OccupancyBytes,omitempty"`
+
+	L3TotalBwBytes int32 `json:"L3TotalBwBytes,omitempty"`
+
+	L3LocalBwBytes int32 `json:"L3LocalBwBytes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/chipset.go

@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Chipset struct {
+	Uefi *Uefi `json:"Uefi,omitempty"`
+
+	IsNumLockDisabled bool `json:"IsNumLockDisabled,omitempty"`
+
+	BaseBoardSerialNumber string `json:"BaseBoardSerialNumber,omitempty"`
+
+	ChassisSerialNumber string `json:"ChassisSerialNumber,omitempty"`
+
+	ChassisAssetTag string `json:"ChassisAssetTag,omitempty"`
+
+	UseUtc bool `json:"UseUtc,omitempty"`
+
+	// LinuxKernelDirect - Added in v2.2 Builds >=181117
+	LinuxKernelDirect *LinuxKernelDirect `json:"LinuxKernelDirect,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/close_handle.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type CloseHandle struct {
+
+	Handle string `json:"Handle,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/com_port.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  ComPort specifies the named pipe that will be used for the port, with empty string indicating a disconnected port.
+type ComPort struct {
+
+	NamedPipe string `json:"NamedPipe,omitempty"`
+
+	OptimizeForDebugger bool `json:"OptimizeForDebugger,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/compute_system.go

@@ -0,0 +1,27 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ComputeSystem struct {
+
+	Owner string `json:"Owner,omitempty"`
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	HostingSystemId string `json:"HostingSystemId,omitempty"`
+
+	HostedSystem *HostedSystem `json:"HostedSystem,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+
+	VirtualMachine *VirtualMachine `json:"VirtualMachine,omitempty"`
+
+	ShouldTerminateOnLastHandleClosed bool `json:"ShouldTerminateOnLastHandleClosed,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/configuration.go

@@ -0,0 +1,72 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"net/http"
+)
+
+// contextKeys are used to identify the type of value in the context.
+// Since these are string, it is possible to get a short description of the
+// context key for logging and debugging using key.String().
+
+type contextKey string
+
+func (c contextKey) String() string {
+	return "auth " + string(c)
+}
+
+var (
+	// ContextOAuth2 takes a oauth2.TokenSource as authentication for the request.
+	ContextOAuth2    	= contextKey("token")
+
+	// ContextBasicAuth takes BasicAuth as authentication for the request.
+	ContextBasicAuth 	= contextKey("basic")
+
+	// ContextAccessToken takes a string oauth2 access token as authentication for the request.
+	ContextAccessToken 	= contextKey("accesstoken")
+
+	// ContextAPIKey takes an APIKey as authentication for the request
+ 	ContextAPIKey 		= contextKey("apikey")
+)
+
+// BasicAuth provides basic http authentication to a request passed via context using ContextBasicAuth 
+type BasicAuth struct {
+	UserName      string            `json:"userName,omitempty"`
+	Password      string            `json:"password,omitempty"`	
+}
+
+// APIKey provides API key based authentication to a request passed via context using ContextAPIKey
+type APIKey struct {
+	Key 	string
+	Prefix	string
+}
+
+type Configuration struct {
+	BasePath      string            	`json:"basePath,omitempty"`
+	Host          string            	`json:"host,omitempty"`
+	Scheme        string            	`json:"scheme,omitempty"`
+	DefaultHeader map[string]string 	`json:"defaultHeader,omitempty"`
+	UserAgent     string            	`json:"userAgent,omitempty"`
+	HTTPClient 	  *http.Client
+}
+
+func NewConfiguration() *Configuration {
+	cfg := &Configuration{
+		BasePath:      "https://localhost",
+		DefaultHeader: make(map[string]string),
+		UserAgent:     "Swagger-Codegen/2.1.0/go",
+	}
+	return cfg
+}
+
+func (c *Configuration) AddDefaultHeader(key string, value string) {
+	c.DefaultHeader[key] = value
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/console_size.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ConsoleSize struct {
+
+	Height int32 `json:"Height,omitempty"`
+
+	Width int32 `json:"Width,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/container.go

@@ -0,0 +1,35 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Container struct {
+
+	GuestOs *GuestOs `json:"GuestOs,omitempty"`
+
+	Storage *Storage `json:"Storage,omitempty"`
+
+	MappedDirectories []MappedDirectory `json:"MappedDirectories,omitempty"`
+
+	MappedPipes []MappedPipe `json:"MappedPipes,omitempty"`
+
+	Memory *Memory `json:"Memory,omitempty"`
+
+	Processor *Processor `json:"Processor,omitempty"`
+
+	Networking *Networking `json:"Networking,omitempty"`
+
+	HvSocket *HvSocket `json:"HvSocket,omitempty"`
+
+	ContainerCredentialGuard *ContainerCredentialGuardState `json:"ContainerCredentialGuard,omitempty"`
+
+	RegistryChanges *RegistryChanges `json:"RegistryChanges,omitempty"`
+
+	AssignedDevices []Device `json:"AssignedDevices,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/container_credential_guard_state.go

@@ -0,0 +1,25 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ContainerCredentialGuardState struct {
+
+	//  Authentication cookie for calls to a Container Credential Guard instance.
+	Cookie string `json:"Cookie,omitempty"`
+
+	//  Name of the RPC endpoint of the Container Credential Guard instance.
+	RpcEndpoint string `json:"RpcEndpoint,omitempty"`
+
+	//  Transport used for the configured Container Credential Guard instance.
+	Transport string `json:"Transport,omitempty"`
+
+	//  Credential spec used for the configured Container Credential Guard instance.
+	CredentialSpec string `json:"CredentialSpec,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/container_memory_information.go

@@ -0,0 +1,26 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  memory usage as viewed from within the container
+type ContainerMemoryInformation struct {
+
+	TotalPhysicalBytes int32 `json:"TotalPhysicalBytes,omitempty"`
+
+	TotalUsage int32 `json:"TotalUsage,omitempty"`
+
+	CommittedBytes int32 `json:"CommittedBytes,omitempty"`
+
+	SharedCommittedBytes int32 `json:"SharedCommittedBytes,omitempty"`
+
+	CommitLimitBytes int32 `json:"CommitLimitBytes,omitempty"`
+
+	PeakCommitmentBytes int32 `json:"PeakCommitmentBytes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/device.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Device struct {
+
+	//  The interface class guid of the device to assign to container.
+	InterfaceClassGuid string `json:"InterfaceClassGuid,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/devices.go

@@ -0,0 +1,43 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Devices struct {
+
+	ComPorts map[string]ComPort `json:"ComPorts,omitempty"`
+
+	Scsi map[string]Scsi `json:"Scsi,omitempty"`
+
+	VirtualPMem *VirtualPMemController `json:"VirtualPMem,omitempty"`
+
+	NetworkAdapters map[string]NetworkAdapter `json:"NetworkAdapters,omitempty"`
+
+	VideoMonitor *VideoMonitor `json:"VideoMonitor,omitempty"`
+
+	Keyboard *Keyboard `json:"Keyboard,omitempty"`
+
+	Mouse *Mouse `json:"Mouse,omitempty"`
+
+	HvSocket *HvSocket2 `json:"HvSocket,omitempty"`
+
+	EnhancedModeVideo *EnhancedModeVideo `json:"EnhancedModeVideo,omitempty"`
+
+	GuestCrashReporting *GuestCrashReporting `json:"GuestCrashReporting,omitempty"`
+
+	VirtualSmb *VirtualSmb `json:"VirtualSmb,omitempty"`
+
+	Plan9 *Plan9 `json:"Plan9,omitempty"`
+
+	Battery *Battery `json:"Battery,omitempty"`
+
+	FlexibleIov map[string]FlexibleIoDevice `json:"FlexibleIov,omitempty"`
+
+	SharedMemory *SharedMemoryConfiguration `json:"SharedMemory,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/enhanced_mode_video.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type EnhancedModeVideo struct {
+
+	ConnectionOptions *RdpConnectionOptions `json:"ConnectionOptions,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/flexible_io_device.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type FlexibleIoDevice struct {
+
+	EmulatorId string `json:"EmulatorId,omitempty"`
+
+	HostingModel string `json:"HostingModel,omitempty"`
+
+	Configuration []string `json:"Configuration,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestConnection struct {
+
+	//  Use Vsock rather than Hyper-V sockets to communicate with the guest service.
+	UseVsock bool `json:"UseVsock,omitempty"`
+
+	//  Don't disconnect the guest connection when pausing the virtual machine.
+	UseConnectedSuspend bool `json:"UseConnectedSuspend,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_connection_info.go

@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Information about the guest.
+type GuestConnectionInfo struct {
+
+	//  Each schema version x.y stands for the range of versions a.b where a==x  and b<=y. This list comes from the SupportedSchemaVersions field in  GcsCapabilities.
+	SupportedSchemaVersions []Version `json:"SupportedSchemaVersions,omitempty"`
+
+	ProtocolVersion int32 `json:"ProtocolVersion,omitempty"`
+
+	GuestDefinedCapabilities *interface{} `json:"GuestDefinedCapabilities,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_crash_reporting.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestCrashReporting struct {
+
+	WindowsCrashSettings *WindowsCrashReporting `json:"WindowsCrashSettings,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_os.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestOs struct {
+
+	HostName string `json:"HostName,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/guest_state.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type GuestState struct {
+
+	//  The path to an existing file uses for persistent guest state storage.  An empty string indicates the system should initialize new transient, in-memory guest state.
+	GuestStateFilePath string `json:"GuestStateFilePath,omitempty"`
+
+	//  The path to an existing file for persistent runtime state storage.  An empty string indicates the system should initialize new transient, in-memory runtime state.
+	RuntimeStateFilePath string `json:"RuntimeStateFilePath,omitempty"`
+
+	//  If true, the guest state and runtime state files will be used as templates  to populate transient, in-memory state instead of using the files as persistent backing store.
+	ForceTransientState bool `json:"ForceTransientState,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/hosted_system.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HostedSystem struct {
+
+	SchemaVersion *Version `json:"SchemaVersion,omitempty"`
+
+	Container *Container `json:"Container,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocket struct {
+
+	Config *HvSocketSystemConfig `json:"Config,omitempty"`
+
+	EnablePowerShellDirect bool `json:"EnablePowerShellDirect,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_2.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  HvSocket configuration for a VM
+type HvSocket2 struct {
+
+	HvSocketConfig *HvSocketSystemConfig `json:"HvSocketConfig,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_service_config.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type HvSocketServiceConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to this specific service.  If not specified, defaults to the system DefaultBindSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	BindSecurityDescriptor string `json:"BindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to this specific service.  If not specified, defaults to the system DefaultConnectSecurityDescriptor, defined in  HvSocketSystemWpConfig in V1.
+	ConnectSecurityDescriptor string `json:"ConnectSecurityDescriptor,omitempty"`
+
+	//  If true, HvSocket will process wildcard binds for this service/system combination.  Wildcard binds are secured in the registry at  SOFTWARE/Microsoft/Windows NT/CurrentVersion/Virtualization/HvSocket/WildcardDescriptors
+	AllowWildcardBinds bool `json:"AllowWildcardBinds,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/hv_socket_system_config.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  This is the HCS Schema version of the HvSocket configuration. The VMWP version is  located in Config.Devices.IC in V1.
+type HvSocketSystemConfig struct {
+
+	//  SDDL string that HvSocket will check before allowing a host process to bind  to an unlisted service for this specific container/VM (not wildcard binds).
+	DefaultBindSecurityDescriptor string `json:"DefaultBindSecurityDescriptor,omitempty"`
+
+	//  SDDL string that HvSocket will check before allowing a host process to connect  to an unlisted service in the VM/container.
+	DefaultConnectSecurityDescriptor string `json:"DefaultConnectSecurityDescriptor,omitempty"`
+
+	ServiceTable map[string]HvSocketServiceConfig `json:"ServiceTable,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/keyboard.go

@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Keyboard struct {
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/layer.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Layer struct {
+
+	Id string `json:"Id,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	PathType string `json:"PathType,omitempty"`
+
+	//  Unspecified defaults to Enabled
+	Cache string `json:"Cache,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/linux_kernel_direct.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.2
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type LinuxKernelDirect struct {
+	KernelFilePath string `json:"KernelFilePath,omitempty"`
+
+	InitRdPath string `json:"InitRdPath,omitempty"`
+
+	KernelCmdLine string `json:"KernelCmdLine,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_directory.go

@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MappedDirectory struct {
+
+	HostPath string `json:"HostPath,omitempty"`
+
+	HostPathType string `json:"HostPathType,omitempty"`
+
+	ContainerPath string `json:"ContainerPath,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/mapped_pipe.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MappedPipe struct {
+
+	ContainerPipeName string `json:"ContainerPipeName,omitempty"`
+
+	HostPath string `json:"HostPath,omitempty"`
+
+	HostPathType string `json:"HostPathType,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Memory struct {
+
+	SizeInMB int32 `json:"SizeInMB,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_2.go

@@ -0,0 +1,25 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Memory2 struct {
+	SizeInMB int32 `json:"SizeInMB,omitempty"`
+
+	AllowOvercommit bool `json:"AllowOvercommit,omitempty"`
+
+	EnableHotHint bool `json:"EnableHotHint,omitempty"`
+
+	EnableColdHint bool `json:"EnableColdHint,omitempty"`
+
+	EnableEpf bool `json:"EnableEpf,omitempty"`
+
+	// EnableDeferredCommit is private in the schema. If regenerated need to add back.
+	EnableDeferredCommit bool `json:"EnableDeferredCommit,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_information_for_vm.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type MemoryInformationForVm struct {
+
+	VirtualNodeCount int32 `json:"VirtualNodeCount,omitempty"`
+
+	VirtualMachineMemory *VmMemory `json:"VirtualMachineMemory,omitempty"`
+
+	VirtualNodes []VirtualNodeInfo `json:"VirtualNodes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/memory_stats.go

@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Memory runtime statistics
+type MemoryStats struct {
+
+	MemoryUsageCommitBytes int32 `json:"MemoryUsageCommitBytes,omitempty"`
+
+	MemoryUsageCommitPeakBytes int32 `json:"MemoryUsageCommitPeakBytes,omitempty"`
+
+	MemoryUsagePrivateWorkingSetBytes int32 `json:"MemoryUsagePrivateWorkingSetBytes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/modify_setting_request.go

@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ModifySettingRequest struct {
+	ResourcePath string `json:"ResourcePath,omitempty"`
+
+	RequestType string `json:"RequestType,omitempty"`
+
+	Settings interface{} `json:"Settings,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated
+
+	GuestRequest interface{} `json:"GuestRequest,omitempty"` // NOTE: Swagger generated as *interface{}. Locally updated
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/mouse.go

@@ -0,0 +1,13 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Mouse struct {
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/network_adapter.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type NetworkAdapter struct {
+
+	EndpointId string `json:"EndpointId,omitempty"`
+
+	MacAddress string `json:"MacAddress,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/networking.go

@@ -0,0 +1,24 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Networking struct {
+
+	AllowUnqualifiedDnsQuery bool `json:"AllowUnqualifiedDnsQuery,omitempty"`
+
+	DnsSearchList string `json:"DnsSearchList,omitempty"`
+
+	NetworkSharedContainerName string `json:"NetworkSharedContainerName,omitempty"`
+
+	//  Guid in windows; string in linux
+	Namespace string `json:"Namespace,omitempty"`
+
+	NetworkAdapters []string `json:"NetworkAdapters,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_notification.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Notification data that is indicated to components running in the Virtual Machine.
+type PauseNotification struct {
+
+	Reason string `json:"Reason,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/pause_options.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Options for HcsPauseComputeSystem
+type PauseOptions struct {
+
+	SuspensionLevel string `json:"SuspensionLevel,omitempty"`
+
+	HostedNotification *PauseNotification `json:"HostedNotification,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Plan9 struct {
+
+	Shares []Plan9Share `json:"Shares,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/plan9_share.go

@@ -0,0 +1,33 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Plan9Share struct {
+
+	Name string `json:"Name,omitempty"`
+
+	//  The name by which the guest operation system can access this share, via  the aname parameter in the Plan9 protocol.
+	AccessName string `json:"AccessName,omitempty"`
+
+	Path string `json:"Path,omitempty"`
+
+	Port int32 `json:"Port,omitempty"`
+
+	// Flags are marked private. Until they are exported correctly
+	//
+	// ReadOnly      0x00000001
+	// LinuxMetadata 0x00000004
+	// CaseSensitive 0x00000008
+	Flags int32 `json:"Flags,omitempty"`
+
+	ReadOnly bool `json:"ReadOnly,omitempty"`
+
+	UseShareRootIdentity bool `json:"UseShareRootIdentity,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_details.go

@@ -0,0 +1,34 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"time"
+)
+
+//  Information about a process running in a container
+type ProcessDetails struct {
+
+	ProcessId int32 `json:"ProcessId,omitempty"`
+
+	ImageName string `json:"ImageName,omitempty"`
+
+	CreateTimestamp time.Time `json:"CreateTimestamp,omitempty"`
+
+	UserTime100ns int32 `json:"UserTime100ns,omitempty"`
+
+	KernelTime100ns int32 `json:"KernelTime100ns,omitempty"`
+
+	MemoryCommitBytes int32 `json:"MemoryCommitBytes,omitempty"`
+
+	MemoryWorkingSetPrivateBytes int32 `json:"MemoryWorkingSetPrivateBytes,omitempty"`
+
+	MemoryWorkingSetSharedBytes int32 `json:"MemoryWorkingSetSharedBytes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_modify_request.go

@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Passed to HcsRpc_ModifyProcess
+type ProcessModifyRequest struct {
+
+	Operation string `json:"Operation,omitempty"`
+
+	ConsoleSize *ConsoleSize `json:"ConsoleSize,omitempty"`
+
+	CloseHandle *CloseHandle `json:"CloseHandle,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_parameters.go

@@ -0,0 +1,47 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type ProcessParameters struct {
+
+	ApplicationName string `json:"ApplicationName,omitempty"`
+
+	CommandLine string `json:"CommandLine,omitempty"`
+
+	//  optional alternative to CommandLine, currently only supported by Linux GCS
+	CommandArgs []string `json:"CommandArgs,omitempty"`
+
+	User string `json:"User,omitempty"`
+
+	WorkingDirectory string `json:"WorkingDirectory,omitempty"`
+
+	Environment map[string]string `json:"Environment,omitempty"`
+
+	//  if set, will run as low-privilege process
+	RestrictedToken bool `json:"RestrictedToken,omitempty"`
+
+	//  if set, ignore StdErrPipe
+	EmulateConsole bool `json:"EmulateConsole,omitempty"`
+
+	CreateStdInPipe bool `json:"CreateStdInPipe,omitempty"`
+
+	CreateStdOutPipe bool `json:"CreateStdOutPipe,omitempty"`
+
+	CreateStdErrPipe bool `json:"CreateStdErrPipe,omitempty"`
+
+	//  height then width
+	ConsoleSize []int32 `json:"ConsoleSize,omitempty"`
+
+	//  if set, find an existing session for the user and create the process in it
+	UseExistingLogin bool `json:"UseExistingLogin,omitempty"`
+
+	//  if set, use the legacy console instead of conhost
+	UseLegacyConsole bool `json:"UseLegacyConsole,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/process_status.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Status of a process running in a container
+type ProcessStatus struct {
+
+	ProcessId int32 `json:"ProcessId,omitempty"`
+
+	Exited bool `json:"Exited,omitempty"`
+
+	ExitCode int32 `json:"ExitCode,omitempty"`
+
+	LastWaitResult int32 `json:"LastWaitResult,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Processor struct {
+
+	Count int32 `json:"Count,omitempty"`
+
+	Maximum int32 `json:"Maximum,omitempty"`
+
+	Weight int32 `json:"Weight,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_2.go

@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Processor2 struct {
+
+	Count int32 `json:"Count,omitempty"`
+
+	Limit int32 `json:"Limit,omitempty"`
+
+	Weight int32 `json:"Weight,omitempty"`
+
+	ExposeVirtualizationExtensions bool `json:"ExposeVirtualizationExtensions,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/processor_stats.go

@@ -0,0 +1,20 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  CPU runtime statistics
+type ProcessorStats struct {
+
+	TotalRuntime100ns int32 `json:"TotalRuntime100ns,omitempty"`
+
+	RuntimeUser100ns int32 `json:"RuntimeUser100ns,omitempty"`
+
+	RuntimeKernel100ns int32 `json:"RuntimeKernel100ns,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/properties.go

@@ -0,0 +1,47 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Properties struct {
+
+	Id string `json:"Id,omitempty"`
+
+	SystemType string `json:"SystemType,omitempty"`
+
+	RuntimeOsType string `json:"RuntimeOsType,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Owner string `json:"Owner,omitempty"`
+
+	RuntimeId string `json:"RuntimeId,omitempty"`
+
+	RuntimeTemplateId string `json:"RuntimeTemplateId,omitempty"`
+
+	State string `json:"State,omitempty"`
+
+	Stopped bool `json:"Stopped,omitempty"`
+
+	ExitType string `json:"ExitType,omitempty"`
+
+	Memory *MemoryInformationForVm `json:"Memory,omitempty"`
+
+	Statistics *Statistics `json:"Statistics,omitempty"`
+
+	ProcessList []ProcessDetails `json:"ProcessList,omitempty"`
+
+	TerminateOnLastHandleClosed bool `json:"TerminateOnLastHandleClosed,omitempty"`
+
+	HostingSystemId string `json:"HostingSystemId,omitempty"`
+
+	SharedMemoryRegionInfo []SharedMemoryRegionInfo `json:"SharedMemoryRegionInfo,omitempty"`
+
+	GuestConnectionInfo *GuestConnectionInfo `json:"GuestConnectionInfo,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/property_query.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//   By default the basic properties will be returned. This query provides a way to  request specific properties. 
+type PropertyQuery struct {
+
+	PropertyTypes []string `json:"PropertyTypes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/rdp_connection_options.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RdpConnectionOptions struct {
+
+	AccessSids []string `json:"AccessSids,omitempty"`
+
+	NamedPipe string `json:"NamedPipe,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_changes.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryChanges struct {
+
+	AddValues []RegistryValue `json:"AddValues,omitempty"`
+
+	DeleteKeys []RegistryKey `json:"DeleteKeys,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_key.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryKey struct {
+
+	Hive string `json:"Hive,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Volatile bool `json:"Volatile,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/registry_value.go

@@ -0,0 +1,31 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RegistryValue struct {
+
+	Key *RegistryKey `json:"Key,omitempty"`
+
+	Name string `json:"Name,omitempty"`
+
+	Type_ string `json:"Type,omitempty"`
+
+	//  One and only one value type must be set.
+	StringValue string `json:"StringValue,omitempty"`
+
+	BinaryValue string `json:"BinaryValue,omitempty"`
+
+	DWordValue int32 `json:"DWordValue,omitempty"`
+
+	QWordValue int32 `json:"QWordValue,omitempty"`
+
+	//  Only used if RegistryValueType is CustomType  The data is in BinaryValue
+	CustomType int32 `json:"CustomType,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/restore_state.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type RestoreState struct {
+
+	//  The path to the save state file to restore the system from.
+	SaveStateFilePath string `json:"SaveStateFilePath,omitempty"`
+
+	//  The ID of the template system to clone this new system off of. An empty  string indicates the system should not be cloned from a template.
+	TemplateSystemId string `json:"TemplateSystemId,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/save_options.go

@@ -0,0 +1,19 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SaveOptions struct {
+
+	//  The type of save operation to be performed.
+	SaveType string `json:"SaveType,omitempty"`
+
+	//  The path to the file that will container the saved state.
+	SaveStateFilePath string `json:"SaveStateFilePath,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/scsi.go

@@ -0,0 +1,16 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Scsi struct {
+
+	//  Map of attachments, where the key is the integer LUN number on the controller.
+	Attachments map[string]Attachment `json:"Attachments,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_configuration.go

@@ -0,0 +1,15 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryConfiguration struct {
+
+	Regions []SharedMemoryRegion `json:"Regions,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region.go

@@ -0,0 +1,23 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryRegion struct {
+
+	SectionName string `json:"SectionName,omitempty"`
+
+	StartOffset int32 `json:"StartOffset,omitempty"`
+
+	Length int32 `json:"Length,omitempty"`
+
+	AllowGuestWrite bool `json:"AllowGuestWrite,omitempty"`
+
+	HiddenFromGuest bool `json:"HiddenFromGuest,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/shared_memory_region_info.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type SharedMemoryRegionInfo struct {
+
+	SectionName string `json:"SectionName,omitempty"`
+
+	GuestPhysicalAddress int32 `json:"GuestPhysicalAddress,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/silo_properties.go

@@ -0,0 +1,18 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Silo job information
+type SiloProperties struct {
+
+	Enabled bool `json:"Enabled,omitempty"`
+
+	JobName string `json:"JobName,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/statistics.go

@@ -0,0 +1,30 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+import (
+	"time"
+)
+
+//  Runtime statistics for a container
+type Statistics struct {
+
+	Timestamp time.Time `json:"Timestamp,omitempty"`
+
+	ContainerStartTime time.Time `json:"ContainerStartTime,omitempty"`
+
+	Uptime100ns int32 `json:"Uptime100ns,omitempty"`
+
+	Processor *ProcessorStats `json:"Processor,omitempty"`
+
+	Memory *MemoryStats `json:"Memory,omitempty"`
+
+	Storage *StorageStats `json:"Storage,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/storage.go

@@ -0,0 +1,21 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Storage struct {
+
+	//  List of layers that describe the parent hierarchy for a container's  storage. These layers combined together, presented as a disposable  and/or committable working storage, are used by the container to  record all changes done to the parent layers.
+	Layers []Layer `json:"Layers,omitempty"`
+
+	//  Path that points to the scratch space of a container, where parent  layers are combined together to present a new disposable and/or committable  layer with the changes done during its runtime.
+	Path string `json:"Path,omitempty"`
+
+	QoS *StorageQoS `json:"QoS,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_qo_s.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type StorageQoS struct {
+
+	IopsMaximum int32 `json:"IopsMaximum,omitempty"`
+
+	BandwidthMaximum int32 `json:"BandwidthMaximum,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/storage_stats.go

@@ -0,0 +1,22 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+//  Storage runtime statistics
+type StorageStats struct {
+
+	ReadCountNormalized int32 `json:"ReadCountNormalized,omitempty"`
+
+	ReadSizeBytes int32 `json:"ReadSizeBytes,omitempty"`
+
+	WriteCountNormalized int32 `json:"WriteCountNormalized,omitempty"`
+
+	WriteSizeBytes int32 `json:"WriteSizeBytes,omitempty"`
+}

vendor/github.com/Microsoft/hcsshim/internal/schema2/topology.go

@@ -0,0 +1,17 @@
+/*
+ * HCS API
+ *
+ * No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)
+ *
+ * API version: 2.1
+ * Generated by: Swagger Codegen (https://github.com/swagger-api/swagger-codegen.git)
+ */
+
+package hcsschema
+
+type Topology struct {
+
+	Memory *Memory2 `json:"Memory,omitempty"`
+
+	Processor *Processor2 `json:"Processor,omitempty"`
+}